Acridone
PubChem CID: 2015
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | acridone, 578-95-0, 9(10H)-Acridone, acridin-9(10H)-one, 9-Acridone, Acridanone, 9(10H)-ACRIDINONE, 10H-acridin-9-one, 9-Acridanone, Acridin-9-one, 9(10H)-Acridanone, 9,10-Dihydro-9-oxoacridine, Acridine, 9,10-dihydro-9-oxo-, MFCD00005019, CCRIS 3317, UNII-6BK306GUQA, EINECS 209-434-7, 6BK306GUQA, 9,10-dihydroacridin-9-one, NSC 408196, 9(10H)acridone, BRN 0007104, 7H-Dibenz(a,j)acrid-14-one, CHEBI:50756, AI3-00868, ACRIDIN-9-OL, NSC-408196, 9,l0-Dihydro-9-oxoacridine, MLS000551242, 643-62-9, DTXSID8060371, 5-21-09-00007 (Beilstein Handbook Reference), SMR000112235, Acridine,10-dihydro-9-oxo-, 7H-DIBENZ[A,J]ACRID-14-ONE, 9-Acridinol, 9Acridanone, Acridin9one, 9Acridone, 9-hydroxyacridine, Acridone (Standard), 9(10H)Acridanone, 9(10H)Acridinone, 9(10H) acridone, 9-(10H)acridone, 9(10)H-Acridone, acridine, 9-hydroxy-, 9-Azaanthracen-10-one, 9,10Dihydro9oxoacridine, cid_2015, Acridine, 9,10dihydro9oxo, SCHEMBL19289, CHEMBL436589, 9(10H)-Acridanone, 99%, DTXCID8042264, BDBM74759, NSC7664, HMS2271C03, BCP25846, HY-W007771R, NSC-7664, MFCD00127712, NSC138672, NSC408196, STK803038, AKOS000119816, AKOS002257157, CS-W007771, FA01197, HY-W007771, NSC-138672, NCGC00246256-01, AS-17382, SY035720, DB-053127, A0133, NS00006605, EN300-18139, C20142, AB00572676-08, AE-641/00183032, Q342721, Z57205009, F0486-2424, 9-Acridone Acridanone Acridin-9-one Acridine, 9,10-dihydro-9-oxo- Dihydroketoacridine |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 29.1 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1C2CCCCC2CC2CCCCC21 |
| Np Classifier Class | Acridone alkaloids |
| Deep Smiles | O=ccccccc6[nH]cc%10cccc6 |
| Heavy Atom Count | 15.0 |
| Classyfire Class | Quinolines and derivatives |
| Scaffold Graph Node Level | OC1C2CCCCC2NC2CCCCC21 |
| Classyfire Subclass | Benzoquinolines |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 239.0 |
| Database Name | hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 10H-acridin-9-one |
| Class | Quinolines and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 3.0 |
| Superclass | Organoheterocyclic compounds |
| Subclass | Benzoquinolines |
| Gsk 4 400 Rule | True |
| Molecular Formula | C13H9NO |
| Scaffold Graph Node Bond Level | O=c1c2ccccc2[nH]c2ccccc12 |
| Inchi Key | FZEYVTFCMJSGMP-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | 9,10-Dihydro-9-oxoacridine, 9-Acridone, Acridanone, 9(10H)-Acridone, 9-Azaanthracen-10-one, Acridone, acridone |
| Esol Class | Soluble |
| Functional Groups | c=O, c[nH]c |
| Compound Name | Acridone |
| Kingdom | Organic compounds |
| Exact Mass | 195.068 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 195.068 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 195.22 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C13H9NO/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13/h1-8H,(H,14,15) |
| Smiles | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3N2 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Acridones |
| Np Classifier Superclass | Anthranilic acid alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Atalantia Monophylla (Plant) Rel Props:Reference:ISBN:9788172360481 - 2. Outgoing r'ship
FOUND_INto/from Glycosmis Pentaphylla (Plant) Rel Props:Reference:ISBN:9788172360818 - 3. Outgoing r'ship
FOUND_INto/from Ruta Graveolens (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/15110689 - 4. Outgoing r'ship
FOUND_INto/from Toddalia Asiatica (Plant) Rel Props:Reference:ISBN:9788185042114