(-)-Gallocatechin gallate
PubChem CID: 199472
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (-)-Gallocatechin gallate, 4233-96-9, (-)-Gallocatechol gallate, (2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl 3,4,5-trihydroxybenzoate, Gallocatechin gallate, (-)-, [(2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate, Gallocatechol, 3-gallate, (-)-, (2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol 3-(3,4,5-trihydroxybenzoate), IRW3C4Y31Q, (-)-Gallocatechin 3-gallate, CCRIS 9286, (-)-gallocatechin-3-O-gallate, L-GCG, MFCD00214298, NVP-XAA 225, CHEMBL264938, (-)-Gallocatechin 3-O-gallate, CHEBI:156271, DTXSID20195144, Benzoic acid, 3,4,5-trihydroxy-, 3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester, (2S-trans)-, (2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl 3,4,5-trihydroxybenzoate, (2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3-yl 3,4,5-trihydroxybenzoate, BENZOIC ACID, 3,4,5-TRIHYDROXY-, (2S,3R)-3,4-DIHYDRO-5,7-DIHYDROXY-2-(3,4,5-TRIHYDROXYPHENYL)-2H-1-BENZOPYRAN-3-YL ESTER, UNII-IRW3C4Y31Q, GCG, ent-Gallocatechin 3-gallate, SCHEMBL49461, CHEBI:95002, HY-N0522R, DTXCID30117635, WMBWREPUVVBILR-NQIIRXRSSA-N, HY-N0522, BDBM50236531, s9058, (-)-Gallocatechin gallate (Standard), AKOS015901852, AC-6044, CCG-269313, CS-7698, FG40482, Gallocatechol, 3-gallate, (-)-(8CI), NCGC00390250-01, 1ST40201, BS-50638, DA-59404, (-)-Gallocatechin gallate, analytical standard, A11681, BRD-K19216856-001-01-9, Q27166763, (-)-Gallocatechin gallate, from green tea, >=98% (HPLC), (2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl3,4,5-trihydroxybenzoate, (-)-GALLOCATECHIN-3-O-GALLATE (GCG) (CONSTITUENT OF POWDERED DECAFFEINATED GREEN TEA EXTRACT), 636-979-1 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 197.0 |
| Hydrogen Bond Donor Count | 8.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC(CC1CC2CCCCC2CC1C1CCCCC1)C1CCCCC1 |
| Np Classifier Class | Flavan-3-ols |
| Deep Smiles | OcccO)ccc6)O[C@H][C@@H]C6)OC=O)cccO)ccc6)O))O))))))))cccO)ccc6)O))O |
| Heavy Atom Count | 33.0 |
| Classyfire Class | Flavonoids |
| Description | Ent-gallocatechin 3-gallate, also known as (-)-gallocatechol gallic acid, is a member of the class of compounds known as catechin gallates. Catechin gallates are organic compounds containing a gallate moiety glycosidically linked to a catechin. Ent-gallocatechin 3-gallate is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Ent-gallocatechin 3-gallate can be found in tea, which makes ent-gallocatechin 3-gallate a potential biomarker for the consumption of this food product. |
| Scaffold Graph Node Level | OC(OC1CC2CCCCC2OC1C1CCCCC1)C1CCCCC1 |
| Classyfire Subclass | Flavans |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 667.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Uniprot Id | Q965D7, Q965D5, Q965D6, P11412, P52209, P08581, n.a., P10415, P08238, A0A024AXB9, P28074, P37840 |
| Iupac Name | [(2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| Prediction Hob | 0.0 |
| Class | Flavonoids |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Target Id | NPT1336, NPT1337, NPT980, NPT1429, NPT1187, NPT920 |
| Xlogp | 1.2 |
| Superclass | Phenylpropanoids and polyketides |
| Subclass | Flavonoid glycosides |
| Gsk 4 400 Rule | False |
| Molecular Formula | C22H18O11 |
| Scaffold Graph Node Bond Level | O=C(OC1Cc2ccccc2OC1c1ccccc1)c1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | WMBWREPUVVBILR-NQIIRXRSSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.1363636363636363 |
| Logs | -3.89 |
| Rotatable Bond Count | 4.0 |
| Logd | 0.75 |
| Synonyms | (-)-Gallocatechin 3-O-gallate, 3,3',4',5,5',7-Hexahydroxyflavan, (2S,3R)-form, 3-O-(3,4,5-Trihydroxybenzoyl), ent-Gallocatechin 3-gallate, L-Gallocatechin 3-gallate, (-)-Gallocatechin-3-O-gallate, (-)-Gallocatechol gallate, (2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol 3-(3,4,5-trihydroxybenzoate), (2S,3R)-5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3-yl 3,4,5-trihydroxybenzoate, (-)-Gallocatechin-3-O-gallic acid, (-)-Gallocatechol gallic acid, (2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol 3-(3,4,5-trihydroxybenzoic acid), (2S,3R)-5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3-yl 3,4,5-trihydroxybenzoic acid, (-)-Gallocatechin gallic acid, Gallocatechin gallate, Gallocatechin-3-gallate, ent-Gallocatechin 3-gallic acid, gallocatechin gallate, gallocatechin gallate,(-)- |
| Esol Class | Soluble |
| Functional Groups | cC(=O)OC, cO, cOC |
| Compound Name | (-)-Gallocatechin gallate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 458.085 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 458.085 |
| Hydrogen Bond Acceptor Count | 11.0 |
| Molecular Weight | 458.4 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Lipinski Rule Of 5 | False |
| Esol | -3.558661363636364 |
| Inchi | InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21+/m1/s1 |
| Smiles | C1[C@H]([C@@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
| Nring | 4.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Flavonoid O-glycosides |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Source_db:npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Morus Alba (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Paeonia Lactiflora (Plant) Rel Props:Source_db:npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Solanum Nigrum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all