1,3-Dihydroxyanthraquinone
PubChem CID: 196978
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Xanthopurpurin, 518-83-2, 1,3-Dihydroxyanthraquinone, Purpuro, 1,3-dihydroxyanthracene-9,10-dione, Purpuroxathin, Purpuroxathine, Xanthopurpin, Purpuroxanthin, 1,3-Dihydroxy-9,10-anthracenedione, 1,3-dihydroxy-9,10-anthraquinone, CCRIS 3523, Anthraquinone, 1,3-dihydroxy-, 9,10-Anthracenedione, 1,3-dihydroxy-, UNII-9RBB2G1GQB, 9RBB2G1GQB, 9,10-Anthracenedione,1,3-dihydroxy-, BRN 1979394, XANTHOPURPURINE, CHEBI:37502, C.I. 75340, 1,3-Dihydroxy-Anthraquinone, 4-08-00-03259 (Beilstein Handbook Reference), 1,3-DIHYDROXY-9,10-DIHYDROANTHRACENE-9,10-DIONE, C14H8O4, Purpuro (Ligand 1), 9,10-Anthracenedione, 1,3-dihydroxy- (9CI), CHEMBL372711, SCHEMBL1426707, DTXSID6075431, GLXC-17927, HY-N7619, BDBM50400183, AKOS015963955, DA-59800, MS-23397, 1,3-Dihydroxy-9,10-anthracenedione, 9CI, CS-0134802, NS00014405, G12328, Q4545678, InChI=1/C14H8O4/c15-7-5-10-12(11(16)6-7)14(18)9-4-2-1-3-8(9)13(10)17/h1-6,15-16 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 74.6 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1C2CCCCC2C(C)C2CCCCC12 |
| Np Classifier Class | Anthraquinones and anthrones |
| Deep Smiles | OcccO)ccc6)C=O)ccC6=O))cccc6 |
| Heavy Atom Count | 18.0 |
| Classyfire Class | Anthracenes |
| Description | obtained from Asperula odorata (sweet wooddruff). Xanthopurpurin is found in tea, herbs and spices, and beverages. |
| Scaffold Graph Node Level | OC1C2CCCCC2C(O)C2CCCCC12 |
| Classyfire Subclass | Anthraquinones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 378.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | n.a., P10415, Q07820 |
| Iupac Name | 1,3-dihydroxyanthracene-9,10-dione |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Anthracenes |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Target Id | NPT980, NPT57 |
| Xlogp | 3.2 |
| Superclass | Benzenoids |
| Is Pains | True |
| Subclass | Anthraquinones |
| Gsk 4 400 Rule | True |
| Molecular Formula | C14H8O4 |
| Scaffold Graph Node Bond Level | O=C1c2ccccc2C(=O)c2ccccc21 |
| Prediction Swissadme | 0.0 |
| Inchi Key | WPWWKBNOXTZDQJ-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.0 |
| Logs | -4.931 |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Logd | 2.753 |
| Synonyms | 1,3-dihydroxy-9,10-anthracenedione, 1,3-Dihydroxy-9,10-anthracenedione, 9CI, 1,3-dihydroxy-9,10-anthraquinone, 1,3-Dihydroxy-anthraquinone, 1,3-dihydroxyanthracene-9,10-dione, 1,3-Dihydroxyanthraquinone, 2-(Methoxymethyl)-1,3-dihydroxyanthraquinone, 9,10-Anthracenedione, 1,3-dihydroxy-, 9,10-Anthracenedione, 1,3-dihydroxy- (9CI), Anthraquinone, 1,3-dihydroxy-, Lucidin omega-methyl ether, Purpuro, Purpuroxanthin, Purpuroxanthine, Purpuroxathin, Purpuroxathine, Xanthopurpin, Xanthopurpurin, 1,3-Dihydroxy-9,10-anthracenedione, 1,3-Dihydroxy-9,10-anthraquinone, 1,3-Dihydroxy-9,10-anthracenedione, 9ci, 1,3-Dihydroxyanthracene-9,10-dione, 9,10-Anthracenedione, 1,3-dihydroxy- (9ci), 1,3-dihydroxyanthraquinone, purpuroxanthin(xanthopurpurin), xanthopurpurin |
| Esol Class | Soluble |
| Functional Groups | cC(c)=O, cO |
| Compound Name | 1,3-Dihydroxyanthraquinone |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 240.042 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 240.042 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 240.21 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -3.813460133333333 |
| Inchi | InChI=1S/C14H8O4/c15-7-5-10-12(11(16)6-7)14(18)9-4-2-1-3-8(9)13(10)17/h1-6,15-16H |
| Smiles | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC(=C3)O)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Hydroxyanthraquinones |
| Np Classifier Superclass | Polycyclic aromatic polyketides |
- 1. Outgoing r'ship
FOUND_INto/from Alangium Platanifolium (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Asperula Odora (Plant) Rel Props:Source_db:npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Asperula Odorata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Croton Penduliflorus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Gynochthodes Umbellata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Ipomoea Cairica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Knoxia Valerianoides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Litsea Konishii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Lychnophora Columnaris (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Morinda Umbellata (Plant) Rel Props:Source_db:npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Populus Tomentosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Rubia Akane (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Rubia Cordifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Rubia Tinctorum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Rubia Wallichiana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Rubia Yunnanensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Vepris Louisii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all