N(5)-Acetyl-L-ornithine
PubChem CID: 193343
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2185-16-2, N(5)-Acetyl-L-ornithine, N(delta)-Acetylornithine, (S)-5-Acetamido-2-aminopentanoic acid, n5-acetyl-l-ornithine, n5-acetylornithine, (2S)-5-acetamido-2-aminopentanoic acid, N~5~-acetyl-L-ornithine, 516JQZ64WQ, (2S)-2-amino-5-acetamidopentanoic acid, L-Ornithine, N5-acetyl-, MFCD30600521, 5-N-acetyl-l-ornithine, UNII-516JQZ64WQ, N-Acetylornithine [USP-RS], SCHEMBL976174, ORNITHINE, N5-ACETYL-, CHEBI:44673, .OMEGA.-N-ACETYLORNITHINE, DTXSID701314796, .DELTA.-ACETYL-L-ORNITHINE, N.DELTA.-ACETYL-L-ORNITHINE, ORNITHINE, N5-ACETYL-, L-, BS-52127, FA168172, CS-0199368, EN300-25983812, Q27120569 |
|---|---|
| Topological Polar Surface Area | 92.4 |
| Hydrogen Bond Donor Count | 3.0 |
| Heavy Atom Count | 12.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 170.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | (2S)-5-acetamido-2-aminopentanoic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Carboxylic acids and derivatives |
| Xlogp | -3.7 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C7H14N2O3 |
| Prediction Swissadme | 0.0 |
| Inchi Key | SRXKAYJJGAAOBP-LURJTMIESA-N |
| Fcsp3 | 0.7142857142857143 |
| Rotatable Bond Count | 5.0 |
| Synonyms | N(delta)-Acetylornithine, N(Δ)-acetylornithine, N(delta)-Acetylornithine, (DL)-isomer, N-Acetylornithine, delta-N-Acetylornithine, (2S)-2-Acetamido-5-aminopentanoic acid, (2S)-2-Amino-5-acetamidopentanoic acid, (2S)-5-Amino-2-acetamidopentanoic acid, N(delta)-Acetyl-L-ornithine, N(Δ)-acetyl-L-ornithine, N-Acetyl-L-ornithine, N-delta-Acetylornithine, N-Δ-acetylornithine, N5-Acetyl-L-ornithine, Ndelta-acetyl-L-ornithine, Ndelta-acetylornithine, Nδ-acetyl-L-ornithine, Nδ-acetylornithine, delta-Acetyl-L-ornithine, Omega-N-acetylornithine, Δ-acetyl-L-ornithine, Ω-N-acetylornithine, N5-Acetylornithine |
| Compound Name | N(5)-Acetyl-L-ornithine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 174.1 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 174.1 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 174.2 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | 1.2810600000000005 |
| Inchi | InChI=1S/C7H14N2O3/c1-5(10)9-4-2-3-6(8)7(11)12/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
| Smiles | CC(=O)NCCC[C@@H](C(=O)O)N |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | L-alpha-amino acids |
- 1. Outgoing r'ship
FOUND_INto/from Artocarpus Altilis (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Cathormion Altissimum (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Centaurea Solstitialis (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Chara Ceratophylla (Plant) Rel Props:Source_db:cmaup_ingredients - 5. Outgoing r'ship
FOUND_INto/from Cosmos Diversifolius (Plant) Rel Props:Source_db:cmaup_ingredients - 6. Outgoing r'ship
FOUND_INto/from Curcuma Caesia (Plant) Rel Props:Source_db:cmaup_ingredients - 7. Outgoing r'ship
FOUND_INto/from Erythrina Pallida (Plant) Rel Props:Source_db:cmaup_ingredients - 8. Outgoing r'ship
FOUND_INto/from Erythrophleum Couminga (Plant) Rel Props:Source_db:cmaup_ingredients - 9. Outgoing r'ship
FOUND_INto/from Eucalyptus Australiana (Plant) Rel Props:Source_db:cmaup_ingredients - 10. Outgoing r'ship
FOUND_INto/from Inga Velutina (Plant) Rel Props:Source_db:cmaup_ingredients - 11. Outgoing r'ship
FOUND_INto/from Lactuca Serriola (Plant) Rel Props:Source_db:cmaup_ingredients - 12. Outgoing r'ship
FOUND_INto/from Lagochilus Leiacanthus (Plant) Rel Props:Source_db:cmaup_ingredients - 13. Outgoing r'ship
FOUND_INto/from Ocimum Pilosum (Plant) Rel Props:Source_db:cmaup_ingredients - 14. Outgoing r'ship
FOUND_INto/from Onobrychis Viciifolia (Plant) Rel Props:Source_db:cmaup_ingredients - 15. Outgoing r'ship
FOUND_INto/from Phelline Lucida (Plant) Rel Props:Source_db:cmaup_ingredients - 16. Outgoing r'ship
FOUND_INto/from Piptostigma Fugax (Plant) Rel Props:Source_db:cmaup_ingredients - 17. Outgoing r'ship
FOUND_INto/from Rhododendron Mucronatum (Plant) Rel Props:Source_db:cmaup_ingredients - 18. Outgoing r'ship
FOUND_INto/from Rhododendron Ungerni (Plant) Rel Props:Source_db:cmaup_ingredients - 19. Outgoing r'ship
FOUND_INto/from Solenopsis Punctaticeps (Plant) Rel Props:Source_db:cmaup_ingredients - 20. Outgoing r'ship
FOUND_INto/from Strychnos Tricalysioides (Plant) Rel Props:Source_db:cmaup_ingredients - 21. Outgoing r'ship
FOUND_INto/from Trichodesma Incanum (Plant) Rel Props:Source_db:cmaup_ingredients - 22. Outgoing r'ship
FOUND_INto/from Urochloa Decumbens (Plant) Rel Props:Source_db:cmaup_ingredients - 23. Outgoing r'ship
FOUND_INto/from Xanthorrhoea Resinosa (Plant) Rel Props:Source_db:cmaup_ingredients