d-Glycero-l-galacto-octulose
PubChem CID: 18618152
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | d-glycero-l-galacto-octulose, CHEBI:174239, 6-(1,2-dihydroxyethyl)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| Topological Polar Surface Area | 151.0 |
| Hydrogen Bond Donor Count | 7.0 |
| Heavy Atom Count | 16.0 |
| Description | Present in avocado (Persea gratissima), alfalfa (Medicago sativa), roots of opium poppy (Papaver somniferum). D-Glycero-D-manno-octulose is found in avocado, pulses, and fruits. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 236.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6-(1,2-dihydroxyethyl)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| Nih Violation | True |
| Class | Organooxygen compounds |
| Xlogp | -3.5 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Molecular Formula | C8H16O8 |
| Inchi Key | HYWDXGGHANXDIV-UHFFFAOYSA-N |
| Rotatable Bond Count | 3.0 |
| Compound Name | d-Glycero-l-galacto-octulose |
| Kingdom | Organic compounds |
| Exact Mass | 240.085 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 240.085 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 240.21 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Inchi | InChI=1S/C8H16O8/c9-1-3(11)6-4(12)5(13)7(14)8(15,2-10)16-6/h3-7,9-15H,1-2H2 |
| Smiles | C(C(C1C(C(C(C(O1)(CO)O)O)O)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | C-glycosyl compounds |
- 1. Outgoing r'ship
FOUND_INto/from Persea Americana (Plant) Rel Props:Source_db:fooddb_chem_all