D-erythro-L-galacto-Nonulose
PubChem CID: 18618148
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Nonulosonate, D-erythro-L-galacto-Nonulose, CHEBI:169540, 2-(HYDROXYMETHYL)-6-(1,2,3-TRIHYDROXYPROPYL)OXANE-2,3,4,5-TETROL |
|---|---|
| Topological Polar Surface Area | 171.0 |
| Hydrogen Bond Donor Count | 8.0 |
| Heavy Atom Count | 18.0 |
| Description | Isolated from avocado. D-erythro-L-gluco-Nonulose is found in avocado and fruits. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 275.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-(hydroxymethyl)-6-(1,2,3-trihydroxypropyl)oxane-2,3,4,5-tetrol |
| Nih Violation | True |
| Class | Organooxygen compounds |
| Xlogp | -4.1 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Molecular Formula | C9H18O9 |
| Inchi Key | USEZWDIVUDJKCA-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| Compound Name | D-erythro-L-galacto-Nonulose |
| Kingdom | Organic compounds |
| Exact Mass | 270.095 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 270.095 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 270.23 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 7.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Inchi | InChI=1S/C9H18O9/c10-1-3(12)4(13)7-5(14)6(15)8(16)9(17,2-11)18-7/h3-8,10-17H,1-2H2 |
| Smiles | C(C(C(C1C(C(C(C(O1)(CO)O)O)O)O)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | C-glycosyl compounds |
- 1. Outgoing r'ship
FOUND_INto/from Persea Americana (Plant) Rel Props:Source_db:fooddb_chem_all