Loroglossin
PubChem CID: 185907
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Loroglossin, 58139-22-3, Loroglossine, bis[[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl] (2R,3S)-2,3-dihydroxy-2-(2-methylpropyl)butanedioate, beta-D-Glucopyranoside, ((2R,3S)-2,3-dihydroxy-2-(2-methylpropyl)-1,4-dioxo-1,4-butanediyl)bis(oxymethylene-4,1-phenylene) bis-, 1,4-Bis((4-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl)oxy)phenyl)methyl) (2R,3S)-2-((2S)-butan-2-yl)-2,3-dihydroxybutanedioic acid, 1,4-Bis[(4-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)methyl] (2R,3S)-2-[(2S)-butan-2-yl]-2,3-dihydroxybutanedioic acid, bis((4-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl)oxyphenyl)methyl) (2R,3S)-2,3-dihydroxy-2-(2-methylpropyl)butanedioate, MEGxp0_001354, CHEMBL4873128, ACon1_001456, DTXSID40973709, AKOS040762971, NCGC00180487-01, DA-55006, HY-125100, CS-0089318, BRD-K30768645-001-01-0, Bis{[4-(hexopyranosyloxy)phenyl]methyl} 2,3-dihydroxy-2-(2-methylpropyl)butanedioate, bis(4-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)benzyl) (2R,3S)-2,3-dihydroxy-2-isobutylsuccinate |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 292.0 |
| Hydrogen Bond Donor Count | 10.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC(CCC(C)CCC1CCC(CC2CCCCC2)CC1)CCC1CCC(CC2CCCCC2)CC1 |
| Deep Smiles | OC[C@H]O[C@@H]Occcccc6))COC=O)[C@H][C@@]C=O)OCcccccc6))O[C@@H]O[C@H]CO))[C@H][C@@H][C@H]6O))O))O)))))))))))))CCC)C)))O))O))))))))))[C@@H][C@H][C@@H]6O))O))O |
| Heavy Atom Count | 52.0 |
| Classyfire Class | Organooxygen compounds |
| Scaffold Graph Node Level | OC(CCC(O)OCC1CCC(OC2CCCCO2)CC1)OCC1CCC(OC2CCCCO2)CC1 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1110.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 12.0 |
| Iupac Name | bis[[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl] (2R,3S)-2,3-dihydroxy-2-(2-methylpropyl)butanedioate |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -1.1 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C34H46O18 |
| Scaffold Graph Node Bond Level | O=C(CCC(=O)OCc1ccc(OC2CCCCO2)cc1)OCc1ccc(OC2CCCCO2)cc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | QABASLXUKXNHMC-PIFIRMJRSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.5882352941176471 |
| Logs | -2.519 |
| Rotatable Bond Count | 17.0 |
| Logd | 0.239 |
| Synonyms | loroglossin |
| Esol Class | Soluble |
| Functional Groups | CO, COC(C)=O, cO[C@@H](C)OC |
| Compound Name | Loroglossin |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 742.268 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 742.268 |
| Hydrogen Bond Acceptor Count | 18.0 |
| Molecular Weight | 742.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 12.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Esol | -2.8321580307692336 |
| Inchi | InChI=1S/C34H46O18/c1-16(2)11-34(46,33(45)48-15-18-5-9-20(10-6-18)50-32-28(42)26(40)24(38)22(13-36)52-32)29(43)30(44)47-14-17-3-7-19(8-4-17)49-31-27(41)25(39)23(37)21(12-35)51-31/h3-10,16,21-29,31-32,35-43,46H,11-15H2,1-2H3/t21-,22-,23-,24-,25+,26+,27-,28-,29-,31-,32-,34-/m1/s1 |
| Smiles | CC(C)C[C@@]([C@@H](C(=O)OCC1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)(C(=O)OCC3=CC=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| Nring | 4.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
- 1. Outgoing r'ship
FOUND_INto/from Alstonia Yunnanensis (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Amentotaxus Yunnanensis (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Combretum Yunnanensis (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Cremastra Appendiculata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Dactylorhiza Incarnata (Plant) Rel Props:Reference:ISBN:9788172361266 - 6. Outgoing r'ship
FOUND_INto/from Gaultheria Yunnanensis (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Glycyrrhiza Yunnanensis (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Michelia Yunnanensis (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Morus Yunnanensis (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Orchis Mascula (Plant) Rel Props:Reference:ISBN:9788172361266 - 11. Outgoing r'ship
FOUND_INto/from Phlegmariurus Yunnanensis (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Pholidota Yunnanensis (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Pinus Yunnanensis (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Pleione Bulbocodioides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Pleione Maculata (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Pleione Yunnanensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Populus Yunnanensis (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Rauvolfia Yunnanensis (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Rubia Yunnanensis (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Salvia Yunnanensis (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Sinodielsia Yunnanensis (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Torreya Fargesii (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Torreya Yunnanensis (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Walsura Yunnanensis (Plant) Rel Props:Reference: