1,5-Dihydroxy-2-methylanthracene-9,10-dione
PubChem CID: 182449
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 64809-73-0, 1,5-dihydroxy-2-methylanthracene-9,10-dione, 1,5-Dihydroxy-2-methylanthraquinone, 9,10-Anthracenedione, 1,5-dihydroxy-2-methyl-, SCHEMBL23199071, DTXSID80983403, Anthraquinone, 1,5-dihydroxy-2-methyl-, 5,9-dihydroxy-6-methyl-1,10-anthraquinone, 5,9-di-hydroxy-2-methyl-1,10-anthraquinone |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 74.6 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1C2CCCCC2C(C)C2CCCCC12 |
| Np Classifier Class | Anthraquinones and anthrones |
| Deep Smiles | OccC)cccc6C=O)ccC6=O))cO)ccc6 |
| Heavy Atom Count | 19.0 |
| Classyfire Class | Anthracenes |
| Scaffold Graph Node Level | OC1C2CCCCC2C(O)C2CCCCC12 |
| Classyfire Subclass | Anthraquinones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 405.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1,5-dihydroxy-2-methylanthracene-9,10-dione |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 4.1 |
| Is Pains | True |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H10O4 |
| Scaffold Graph Node Bond Level | O=C1c2ccccc2C(=O)c2ccccc21 |
| Inchi Key | AJCZWDJTCCZJJT-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | 1,5- dihydroxy-2-methylanthraquinone, 1,5-dihydroxy-2-methyl anthraquinone, 1,5-dihydroxy-2-methylanthraquinone |
| Esol Class | Moderately soluble |
| Functional Groups | cC(c)=O, cO |
| Compound Name | 1,5-Dihydroxy-2-methylanthracene-9,10-dione |
| Exact Mass | 254.058 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 254.058 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 254.24 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C15H10O4/c1-7-5-6-9-12(13(7)17)15(19)8-3-2-4-10(16)11(8)14(9)18/h2-6,16-17H,1H3 |
| Smiles | CC1=C(C2=C(C=C1)C(=O)C3=C(C2=O)C=CC=C3O)O |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Polycyclic aromatic polyketides |
- 1. Outgoing r'ship
FOUND_INto/from Rubia Cordifolia (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279