Saxalin
PubChem CID: 182277
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Saxalin, 36150-06-8, 4-(3-chloro-2-hydroxy-3-methylbutoxy)furo[3,2-g]chromen-7-one, (+-)-Saxalin, 4-(3-Chloro-2-hydroxy-3-methylbutoxy)-7H-furo[3,2-g][1]benzopyran-7-one, 7H-Furo(3,2-g)(1)benzopyran-7-one, 4-(3-chloro-2-hydroxy-3-methylbutoxy)-, (+/-)-Saxalin, 4-(3-chloro-2-hydroxy-3-methylbutoxy)furo(3,2-g)chromen-7-one, 7H-Furo[3,2-g][1]benzopyran-7-one, 4-(3-chloro-2-hydroxy-3-methylbutoxy)-, (+)-Saxalin, DTXSID60957566, DB-241374, E89012, 4-(3-chloro-2-hydroxy-3-methyl-butoxy)furo[3,2-g]chromen-7-one |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 68.9 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CC3CCCC3CC2C1 |
| Np Classifier Class | Furocoumarins |
| Deep Smiles | O=ccccco6)cccc6OCCCCl)C)C))O)))))cco5 |
| Heavy Atom Count | 22.0 |
| Classyfire Class | Coumarins and derivatives |
| Description | Saxalin is a member of the class of compounds known as psoralens. Psoralens are organic compounds containing a psoralen moiety, which consists of a furan fused to a chromenone to for 7H-furo[3,2-g]chromen-7-one. Saxalin is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Saxalin can be found in parsley, which makes saxalin a potential biomarker for the consumption of this food product. |
| Scaffold Graph Node Level | OC1CCC2CC3CCOC3CC2O1 |
| Classyfire Subclass | Furanocoumarins |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 463.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 4-(3-chloro-2-hydroxy-3-methylbutoxy)furo[3,2-g]chromen-7-one |
| Nih Violation | True |
| Class | Coumarins and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 2.9 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Subclass | Furanocoumarins |
| Gsk 4 400 Rule | True |
| Molecular Formula | C16H15ClO5 |
| Scaffold Graph Node Bond Level | O=c1ccc2cc3ccoc3cc2o1 |
| Inchi Key | QPHPWCUVCZXUEP-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 4.0 |
| Synonyms | (+/-)-saxalin, Saxalin, saxalin |
| Esol Class | Soluble |
| Functional Groups | CCl, CO, c=O, cOC, coc |
| Compound Name | Saxalin |
| Kingdom | Organic compounds |
| Exact Mass | 322.061 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 322.061 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 322.74 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C16H15ClO5/c1-16(2,17)13(18)8-21-15-9-3-4-14(19)22-12(9)7-11-10(15)5-6-20-11/h3-7,13,18H,8H2,1-2H3 |
| Smiles | CC(C)(C(COC1=C2C=CC(=O)OC2=CC3=C1C=CO3)O)Cl |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Psoralens |
| Np Classifier Superclass | Coumarins |
- 1. Outgoing r'ship
FOUND_INto/from Angelica Archangelica (Plant) Rel Props:Reference:ISBN:9770972795006 - 2. Outgoing r'ship
FOUND_INto/from Petroselinum Crispum (Plant) Rel Props:Source_db:fooddb_chem_all