5-Heptadecylresorcinol
PubChem CID: 181700
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5-Heptadecylresorcinol, 5-heptadecylbenzene-1,3-diol, 41442-57-3, 5-N-Heptadecylresorcinol, 5-Heptadecyl-1,3-benzenediol, MXE8ZPJ5XE, 5-Heptadecyl-1,3-dihydroxybenzene, CHEBI:145967, DTXSID50920522, 1,3-dihydroxy-5-n-heptadecylbenzene, 1,3-DIHYDROXY-5-HEPTADECYLBENZENE, 5-Heptadecyl-1,3-benzenediol, 1,3-Dihydroxy-5-heptadecylbenzene, 5-Heptadecylresorcinol, 1,3-Benzenediol, 5-heptadecyl-, UNII-MXE8ZPJ5XE, CHEMBL497530, SCHEMBL1914183, DTXCID101349434, HY-N2673, RBA44257, LMPK15030003, AKOS022184647, FS-9410, 5-Heptadecylresorcinol, analytical standard, DB-340892, CS-0023110, G78900, 664-055-8 |
|---|---|
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 25.0 |
| Description | Isolated from cereal grains. 5-Heptadecyl-1,3-benzenediol is found in many foods, some of which are oat, corn, breakfast cereal, and barley. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 269.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5-heptadecylbenzene-1,3-diol |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Xlogp | 10.1 |
| Is Pains | False |
| Molecular Formula | C23H40O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | BBGNINPPDHJETF-UHFFFAOYSA-N |
| Fcsp3 | 0.7391304347826086 |
| Logs | -3.838 |
| Rotatable Bond Count | 16.0 |
| Logd | 4.761 |
| Synonyms | 5-heptadecylbenzene-1,3-diol, 5-Heptadecylresorcinol |
| Compound Name | 5-Heptadecylresorcinol |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 348.303 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 348.303 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 348.6 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -7.5046402 |
| Inchi | InChI=1S/C23H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-18-22(24)20-23(25)19-21/h18-20,24-25H,2-17H2,1H3 |
| Smiles | CCCCCCCCCCCCCCCCCC1=CC(=CC(=C1)O)O |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Arisarum Vulgare (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Canarium Vulgare (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Clinopodium Vulgare (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Echium Vulgare (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Foeniculum Vulgare (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Hordeum Bulbosum (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Hordeum Vulgare (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Leucanthemum Vulgare (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Leucojum Aestivum (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Ligustrum Vulgare (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Marrubium Vulgare (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Origanum Vulgare (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Polypodium Vulgare (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Protea Mellifera (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Salvia Mellifera (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Secale Cereale (Plant) Rel Props:Source_db:npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Senegalia Mellifera (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Sorghum Vulgare (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Tanacetum Vulgare (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Tripolium Vulgare (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Triticum Aestivum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all; Reference: - 22. Outgoing r'ship
FOUND_INto/from Triticum Durum (Plant) Rel Props:Source_db:npass_chem_all - 23. Outgoing r'ship
FOUND_INto/from Triticum Sativum (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Triticum Vulgare (Plant) Rel Props:Reference: