2-Hydroxy-4-methoxy-3-(3-methylbut-2-en-1-yl)-6-phenethylbenzoic acid
PubChem CID: 17950432
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 80489-90-3, Amorfrutin A, 2-Hydroxy-4-methoxy-3-(3-methylbut-2-en-1-yl)-6-phenethylbenzoic acid, Amorfrutin 1, Amorfrutin, 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoic acid, MLS002630965, SMR001544280, 2-Hydroxy-4-methoxy-3-(3-methylbut-2-en-1-yl)-6-phenethylbenzoicacid, 2-Hydroxy-4-methoxy-3-(3-methylbut-2-en-1-yl)-6-(2-phenylethyl)benzoic acid, CHEMBL491820, SCHEMBL3689670, BDBM91427, DTXSID00591701, CHEBI:195312, cid_17950432, FDA48990, AKOS016012286, DB-293135, Q27467733, 3-hydroxy-4-isopentenyl-5-methoxybibenzyl-2-carboxylic acid, 2-hydroxy-4-methoxy-3-prenyl-6-(2-phenylethyl) benzoic acid, 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-phenethyl-benzoic acid, 4-methoxy-3-(3-methylbut-2-enyl)-2-oxidanyl-6-(2-phenylethyl)benzoic acid, NCGC00384544-01!2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoic acid |
|---|---|
| Topological Polar Surface Area | 66.8 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 25.0 |
| Description | 3-hydroxy-4-isopentenyl-5-methoxybibenzyl-2-carboxylic acid, also known as amorfrutin a, is a member of the class of compounds known as stilbenes. Stilbenes are organic compounds containing a 1,2-diphenylethylene moiety. Stilbenes (C6-C2-C6 ) are derived from the common phenylpropene (C6-C3) skeleton building block. The introduction of one or more hydroxyl groups to a phenyl ring lead to stilbenoids. 3-hydroxy-4-isopentenyl-5-methoxybibenzyl-2-carboxylic acid is practically insoluble (in water) and a moderately acidic compound (based on its pKa). 3-hydroxy-4-isopentenyl-5-methoxybibenzyl-2-carboxylic acid can be found in pigeon pea, which makes 3-hydroxy-4-isopentenyl-5-methoxybibenzyl-2-carboxylic acid a potential biomarker for the consumption of this food product. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 449.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q16236, P39748, P84022, P24387, O75496, P80244, P43220, Q77YF9, P37231, Q03181, Q07869, Q9NUW8, Q8WZA2, Q03431, P53350, P63092 |
| Iupac Name | 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoic acid |
| Prediction Hob | 1.0 |
| Class | Stilbenes |
| Target Id | NPT99 |
| Xlogp | 5.8 |
| Superclass | Phenylpropanoids and polyketides |
| Molecular Formula | C21H24O4 |
| Prediction Swissadme | 0.0 |
| Inchi Key | CTNFTPUIYFUXBE-UHFFFAOYSA-N |
| Fcsp3 | 0.2857142857142857 |
| Logs | -4.181 |
| Rotatable Bond Count | 7.0 |
| Logd | 3.852 |
| Synonyms | Amorfrutin A, Amorfrutin a, 3-Hydroxy-4-isopentenyl-5-methoxybibenzyl-2-carboxylate |
| Compound Name | 2-Hydroxy-4-methoxy-3-(3-methylbut-2-en-1-yl)-6-phenethylbenzoic acid |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 340.167 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 340.167 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 340.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Esol | -5.472597800000001 |
| Inchi | InChI=1S/C21H24O4/c1-14(2)9-12-17-18(25-3)13-16(19(20(17)22)21(23)24)11-10-15-7-5-4-6-8-15/h4-9,13,22H,10-12H2,1-3H3,(H,23,24) |
| Smiles | CC(=CCC1=C(C=C(C(=C1O)C(=O)O)CCC2=CC=CC=C2)OC)C |
| Nring | 2.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Stilbenes |
- 1. Outgoing r'ship
FOUND_INto/from Amorpha Fruticosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Cajanus Cajan (Plant) Rel Props:Source_db:fooddb_chem_all