1,4-Anhydro-D-Ara-onic
PubChem CID: 17723
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | D-Arabinono-1,4-lactone, D-Arabino-1,4-lactone, D-Arabonolactone, 2782-09-4, 1,4-D-Arabinonolactone, (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one, D-Arabonic acid-1,4-lactone, D-Arabinonic acid, gamma-lactone, 42417-44-7, D-Arabinonic Acid gamma-lactone, BRN 0082056, ARABINONIC ACID, gamma-LACTONE, D-, 1,4-Anhydro-D-Ara-onic, Arabinonic acid-1,4-lactone, SCHEMBL419845, CHEBI:16292, CUOKHACJLGPRHD-JJYYJPOSSA-, G26873TS, GEO-04321, AKOS040768084, MA31272, D-Arabino-1,4-lactone, >=95.0% (GC), C00652, D-Arabino-1,4-lactone, >=97.0% (HPLC), 4-18-00-02260 (Beilstein Handbook Reference), Q27101836, E6B670A8-4605-455A-B696-7C0B3A83D3E3, (3S,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)dihydrofuran-2(3H)-one, (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-one, InChI=1/C5H8O5/c6-1-2-3(7)4(8)5(9)10-2/h2-4,6-8H,1H2/t2-,3-,4+/m1/s1, L-Arabinonic acid,2-amino-2,3,5-trideoxy-3-methyl-,g-lactone,hydrochloride(9ci) |
|---|---|
| Topological Polar Surface Area | 87.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | CUOKHACJLGPRHD-JJYYJPOSSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | D-ARABINO-1,4-LACTONE, 1,4-D-Arabinonolactone, D-Arabinonic acid, gamma-lactone, D-Arabonolactone, D-Arabinonate, g-lactone, D-Arabinonate, gamma-lactone, D-Arabinonate, γ-lactone, D-Arabinonic acid, g-lactone, D-Arabinonic acid, γ-lactone |
| Heavy Atom Count | 10.0 |
| Compound Name | 1,4-Anhydro-D-Ara-onic |
| Kingdom | Organic compounds |
| Description | D-arabinono-1,4-lactone, also known as D-arabinonic acid, gamma-lactone, is a member of the class of compounds known as pentoses. Pentoses are monosaccharides in which the carbohydrate moiety contains five carbon atoms. D-arabinono-1,4-lactone is soluble (in water) and a very weakly acidic compound (based on its pKa). D-arabinono-1,4-lactone can be found in rice, which makes D-arabinono-1,4-lactone a potential biomarker for the consumption of this food product. D-arabinono-1,4-lactone may be a unique S.cerevisiae (yeast) metabolite. |
| Exact Mass | 148.037 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 148.037 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 145.0 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 148.11 |
| Database Name | fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one |
| Total Atom Stereocenter Count | 3.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Organooxygen compounds |
| Inchi | InChI=1S/C5H8O5/c6-1-2-3(7)4(8)5(9)10-2/h2-4,6-8H,1H2/t2-,3-,4+/m1/s1 |
| Smiles | C([C@@H]1[C@H]([C@@H](C(=O)O1)O)O)O |
| Xlogp | -1.4 |
| Superclass | Organic oxygen compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Taxonomy Direct Parent | Pentoses |
| Molecular Formula | C5H8O5 |
- 1. Outgoing r'ship
FOUND_INto/from Oryza Sativa (Plant) Rel Props:Source_db:fooddb_chem_all