Curcusone C
PubChem CID: 175942
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Curcusone C, 103630-35-9, CCRIS 1444, DTXSID20908534, 2-Hydroxy-2,5-dimethyl-10-methylidene-7-(prop-1-en-2-yl)-2,3,6a,7,8,9,10,10a-octahydrobenzo[e]azulene-1,4-dione |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 54.4 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CCCC(C)C2C2C(C)CCC12 |
| Np Classifier Class | Rhamnofolane diterpenoids |
| Deep Smiles | CC=C)CCCC=C)C[C@H]6C=CC)C=O)C=C7C=O)[C@@]C5)C)O |
| Heavy Atom Count | 23.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | CC1CCCC2CCC(O)C3CCC(O)C3C12 |
| Classyfire Subclass | Diterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 706.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (2S,6aS)-2-hydroxy-2,5-dimethyl-10-methylidene-7-prop-1-en-2-yl-3,6a,7,8,9,10a-hexahydrobenzo[h]azulene-1,4-dione |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.0 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C20H24O3 |
| Scaffold Graph Node Bond Level | C=C1CCCC2C=CC(=O)C3=C(C(=O)CC3)C12 |
| Inchi Key | DBPPEQIYWCILTJ-DNUKQYJSSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | curcusone c |
| Esol Class | Soluble |
| Functional Groups | C=C(C)C, CC1=CCCC2=C(CCC2=O)C1=O, CO |
| Compound Name | Curcusone C |
| Exact Mass | 312.173 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 312.173 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 312.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C20H24O3/c1-10(2)13-7-6-11(3)16-14(13)8-12(4)18(21)15-9-20(5,23)19(22)17(15)16/h8,13-14,16,23H,1,3,6-7,9H2,2,4-5H3/t13?,14-,16?,20-/m0/s1 |
| Smiles | CC1=C[C@H]2C(CCC(=C)C2C3=C(C1=O)C[C@](C3=O)(C)O)C(=C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Diterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Jatropha Curcas (Plant) Rel Props:Reference:ISBN:9770972795006