1-Pentene-2-ol
PubChem CID: 173840
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1-Pentene-2-ol, 1-Penten-2-ol, 61923-56-6, pent-1-en-2-ol, Penten-2-ol, DTXSID50210955, DB-363727 |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | RTJBLRZRSVEQRH-UHFFFAOYSA-N |
| Rotatable Bond Count | 2.0 |
| Synonyms | 1-penten-2-ol, 1-Pentene-2-ol |
| Heavy Atom Count | 6.0 |
| Compound Name | 1-Pentene-2-ol |
| Description | Pent-1-en-2-ol, also known as 1-penten-2-ol, is a member of the class of compounds known as enols. Enols are compounds containing the enol functional group, with the structure HO(R)C=CR'. Ketones that have one or more alpha-hydrogen atoms undergo keto-enol tautomerization, the tautomer being an enol. Pent-1-en-2-ol is soluble (in water) and a very weakly acidic compound (based on its pKa). Pent-1-en-2-ol can be found in corn, which makes pent-1-en-2-ol a potential biomarker for the consumption of this food product. |
| Exact Mass | 86.0732 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 86.0732 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 47.9 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 86.13 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | pent-1-en-2-ol |
| Total Atom Stereocenter Count | 0.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C5H10O/c1-3-4-5(2)6/h6H,2-4H2,1H3 |
| Smiles | CCCC(=C)O |
| Xlogp | 1.7 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C5H10O |
- 1. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:fooddb_chem_all