L-Fucose
PubChem CID: 17106
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | L-fucose, fucose, 6-deoxy-L-galactose, 6-Deoxy-L-galactopyranose, 6-deoxy-galactose, L-Fuc, 6-deoxy-galactopyranose, 6-Deoxy-Galactopyranoside, 6-Deoxy-L-Galactopyranoside, FUC, L-fucopyranose, 87-96-7, L-galactomethylose, Fucose, L-, (3S,4R,5S,6S)-6-Methyltetrahydro-2H-pyran-2,3,4,5-tetraol, CHEBI:2181, (3S,4R,5S,6S)-6-methyloxane-2,3,4,5-tetrol, CHEMBL469449, 6-Desoxygalactose, DTXSID501016770, (-)-L-Fucose, 6-Deoxy-L-beta-galactose, fucopyranose, Elfucosa, L-Galactopyranose, 6-deoxy-, NSC-1219, 6-methyltetrahydropyran-2,3,4,5-tetraol, bmse000036, Epitope ID:152214, Fucopyranose, L- (7CI), SCHEMBL63943, CERC-803, CHEBI:18287, DTXCID201474965, GLXC-27372, BDBM50242419, L-Galactopyranose, 6-deoxy- (9CI), AKOS016844003, 6-deoxy-L-galactopyranoseL-fucopyranose, NS00015256, C01019, D12571, EN300-6732867, Q409082, O_FULL_00100000000000_GS_657, L-(?)-Fucose, (3S,4R,5S,6S)-6-methyloxane-2,3,4,5-tetrol, 201-785-4 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 90.2 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Disaccharides, Monosaccharides |
| Deep Smiles | O[C@@H][C@H]C)OC[C@H][C@@H]6O))O))O |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Organooxygen compounds |
| Scaffold Graph Node Level | C1CCOCC1 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 139.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Uniprot Id | P04066, n.a., P10323, Q9NNX6, B4EH87, Q9HYN5 |
| Iupac Name | (3S,4R,5S,6S)-6-methyloxane-2,3,4,5-tetrol |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Target Id | NPT503, NPT5646 |
| Xlogp | -2.1 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C6H12O5 |
| Scaffold Graph Node Bond Level | C1CCOCC1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | SHZGCJCMOBCMKK-DHVFOXMCSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 1.0 |
| Logs | 0.308 |
| Rotatable Bond Count | 0.0 |
| Logd | -1.631 |
| Synonyms | fucose, l-fucose |
| Esol Class | Highly soluble |
| Functional Groups | CO, COC(C)O |
| Compound Name | L-Fucose |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 164.068 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 164.068 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 164.16 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | 0.4589266000000001 |
| Inchi | InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3+,4+,5-,6?/m0/s1 |
| Smiles | C[C@H]1[C@H]([C@H]([C@@H](C(O1)O)O)O)O |
| Nring | 1.0 |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Saccharides |
- 1. Outgoing r'ship
FOUND_INto/from Acacia Concinna (Plant) Rel Props:Reference:ISBN:9788185042084 - 2. Outgoing r'ship
FOUND_INto/from Actinidia Chinensis (Plant) Rel Props:Reference:ISBN:9788172362089 - 3. Outgoing r'ship
FOUND_INto/from Albizia Julibrissin (Plant) Rel Props:Reference:ISBN:9788185042084 - 4. Outgoing r'ship
FOUND_INto/from Albizia Procera (Plant) Rel Props:Reference:ISBN:9788185042084 - 5. Outgoing r'ship
FOUND_INto/from Allium Chinense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Allium Macrostemon (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Artocarpus Heterophyllus (Plant) Rel Props:Reference:ISBN:9788172362089 - 8. Outgoing r'ship
FOUND_INto/from Brasenia Schreberi (Plant) Rel Props:Reference:ISBN:9788172362089 - 9. Outgoing r'ship
FOUND_INto/from Datura Innoxia (Plant) Rel Props:Reference:ISBN:9788185042053 - 10. Outgoing r'ship
FOUND_INto/from Dianthus Barbatus (Plant) Rel Props:Reference:ISBN:9788172362300 - 11. Outgoing r'ship
FOUND_INto/from Herniaria Glabra (Plant) Rel Props:Reference:ISBN:9788185042053 - 12. Outgoing r'ship
FOUND_INto/from Ipomoea Indica (Plant) Rel Props:Reference:ISBN:9788185042084 - 13. Outgoing r'ship
FOUND_INto/from Ipomoea Quamoclit (Plant) Rel Props:Reference:ISBN:9788185042114 - 14. Outgoing r'ship
FOUND_INto/from Pogostemon Cablin (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Verbascum Chinense (Plant) Rel Props:Reference:ISBN:9788185042084