1-Decen-3-ol
PubChem CID: 170977
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1-Decen-3-ol, dec-1-en-3-ol, 51100-54-0, 3-Hydroxy-1-decene, UNII-VO05FOL7H0, VO05FOL7H0, EINECS 256-967-6, FEMA NO. 3824, 1-DECEN-3-OL [FHFI], DTXSID20866180, (+/-)-1-DECEN-3-OL, 1-DECEN-3-OL, (+/-)-, SCHEMBL184105, 1-Decen-3-ol, >=98%, FEMA 3824, DTXCID50814497, NSFWLHKFTGZFBP-UHFFFAOYSA-N, 1-Decen-3-ol, analytical standard, LMFA05000597, AKOS013154332, SB84205, CS-0453104, D3268, NS00057537, D90165, Q27291930, 256-967-6 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Fatty alcohols |
| Deep Smiles | CCCCCCCCC=C))O |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Fatty acyls |
| Description | It is used as a food additive |
| Classyfire Subclass | Fatty alcohols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 88.9 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | dec-1-en-3-ol |
| Nih Violation | False |
| Class | Fatty Acyls |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.6 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty alcohols |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H20O |
| Inchi Key | NSFWLHKFTGZFBP-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 7.0 |
| Synonyms | FEMA 3824, dec-1-en-3-ol |
| Esol Class | Soluble |
| Functional Groups | C=CC, CO |
| Compound Name | 1-Decen-3-ol |
| Kingdom | Organic compounds |
| Exact Mass | 156.151 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 156.151 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 156.26 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H20O/c1-3-5-6-7-8-9-10(11)4-2/h4,10-11H,2-3,5-9H2,1H3 |
| Smiles | CCCCCCCC(C=C)O |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Fatty alcohols |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Coriandrum Sativum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2008.10643676 - 2. Outgoing r'ship
FOUND_INto/from Thymus Vulgaris (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2013.813235