UDP-alpha-D-xylose(2-)
PubChem CID: 16667349
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | UDP-alpha-D-xylose, UDP-alpha-D-xylose(2-), Uridine 5'-diphospo-alpha-D-xylopyranoside, UDP-alpha-D-xylose dianion, CHEBI:57632, uridine 5'-[3-(alpha-D-xylopyranosyl) diphosphate], Q27104824, Uridine 5'-(trihydrogen diphosphate), P'-(alpha-D-xylopyranosyl) ester, [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl] phosphate |
|---|---|
| Topological Polar Surface Area | 277.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | DQQDLYVHOTZLOR-OCIMBMBZSA-L |
| Rotatable Bond Count | 8.0 |
| Synonyms | Alpha-d-xylopyranosyl ester, Alpha-delta-xylopyranosyl ester, Udp xylose, Udp-alpha, Udp-alpha-d-xylose, Udp-d-xylose, Udp-delta-xylose, Uridine diphosphate xylose |
| Heavy Atom Count | 34.0 |
| Compound Name | UDP-alpha-D-xylose(2-) |
| Description | Uridine diphosphate xylose is important intermediate in the Nucleotide sugars metabolism and chondroitin sulfate biosynthesis (KEGG), The decarboxylation product of UDPglucuronic acid, which is used for formation of the xylosides of seryl hydroxyl groups in mucoprotein synthesis., Uridine is a molecule (known as a nucleoside) that is formed when uracil is attached to a ribose ring (also known as a ribofuranose) via a ?-N1-glycosidic bond. Udp-xylose is found in soy bean. |
| Exact Mass | 534.029 |
| Formal Charge | -2.0 |
| Monoisotopic Mass | 534.029 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 900.0 |
| Hydrogen Bond Acceptor Count | 16.0 |
| Molecular Weight | 534.26 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 8.0 |
| Iupac Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl] phosphate |
| Total Atom Stereocenter Count | 8.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C14H22N2O16P2/c17-5-3-28-13(11(22)8(5)19)31-34(26,27)32-33(24,25)29-4-6-9(20)10(21)12(30-6)16-2-1-7(18)15-14(16)23/h1-2,5-6,8-13,17,19-22H,3-4H2,(H,24,25)(H,26,27)(H,15,18,23)/p-2/t5-,6-,8+,9-,10-,11-,12-,13-/m1/s1 |
| Smiles | C1[C@H]([C@@H]([C@H]([C@H](O1)OP(=O)([O-])OP(=O)([O-])OC[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=CC(=O)NC3=O)O)O)O)O)O |
| Xlogp | -6.7 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C14H20N2O16P2-2 |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all