gamma-hydroxy-L-arginine
PubChem CID: 164980
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | gamma-Hydroxy-L-arginine, 4-hydroxy-L-arginine, 4-Hydroxyarginine, 61370-10-3, LT9MLJ6CFA, L-Arginine, 4-hydroxy-, CHEBI:47815, (2S)-2-amino-5-(diaminomethylideneamino)-4-hydroxypentanoic acid, (2S)-2-amino-5-{[amino(imino)methyl]amino}-4-hydroxypentanoic acid, (2S)-2-amino-5-[(diaminomethylidene)amino]-4-hydroxypentanoic acid, (2S)-2-amino-5-((amino(imino)methyl)amino)-4-hydroxypentanoic acid, UNII-LT9MLJ6CFA, SCHEMBL296234, DTXSID001315381, C08284, Q27104594 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 148.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Pfizer 3 75 Rule | True |
| Np Classifier Class | Aminoacids |
| Deep Smiles | OCC[C@@H]C=O)O))N)))CN=CN)N |
| Heavy Atom Count | 13.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Classyfire Subclass | Amino acids, peptides, and analogues |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 202.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | (2S)-2-amino-5-(diaminomethylideneamino)-4-hydroxypentanoic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | -5.2 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C6H14N4O3 |
| Prediction Swissadme | 0.0 |
| Inchi Key | OPCBKDJCJYBGTQ-BKLSDQPFSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.6666666666666666 |
| Logs | -0.952 |
| Rotatable Bond Count | 5.0 |
| Logd | -1.888 |
| Synonyms | (2s,3r)-4-hydroxyarginine, 2(s),4(r)-4-hydroxyargenine, gamma-hydroxyarginine |
| Esol Class | Highly soluble |
| Functional Groups | CC(=O)O, CN, CN=C(N)N, CO |
| Compound Name | gamma-hydroxy-L-arginine |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 190.107 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 190.107 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 190.2 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | 2.4007414000000002 |
| Inchi | InChI=1S/C6H14N4O3/c7-4(5(12)13)1-3(11)2-10-6(8)9/h3-4,11H,1-2,7H2,(H,12,13)(H4,8,9,10)/t3?,4-/m0/s1 |
| Smiles | C([C@@H](C(=O)O)N)C(CN=C(N)N)O |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Small peptides |
- 1. Outgoing r'ship
FOUND_INto/from Lens Culinaris (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Senna Obtusifolia (Plant) Rel Props:Reference:ISBN:9788185042114 - 3. Outgoing r'ship
FOUND_INto/from Vicia Sativa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all