Dipotassium malate
PubChem CID: 164689
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Dipotassium malate, 585-09-1, Potassium malate, Butanedioic acid, hydroxy-, dipotassium salt, dipotassium 2-hydroxybutanedioate, UNII-5YO4AE78DB, EINECS 209-549-2, Potassium 2-hydroxysuccinate, 5YO4AE78DB, dipotassium, 2-hydroxybutanedioate, DL-POTASSIUM MALATE, INS NO.351(II), INS-351(II), RACEMIC DIPOTASSIUM MALATE, POTASSIUM MALATE [WHO-DD], MALIC ACID, DIPOTASSIUM SALT, Butanedioic acid, 2-hydroxy-, potassium salt (1:2), E-351(II), POTASSIUM DL-ALPHA-HYDROXYSUCCINATE, Potassium2-hydroxysuccinate, Potassium salt of malic acid, SCHEMBL95331, DTXSID80974053, SVICABYXKQIXBM-UHFFFAOYSA-L, AKOS028109636, AS-66187, DB-251522, NS00080149, A11573, 2-Hydroxy-butanedioic acid potassium salt (1:2), Q408755, 209-549-2 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 100.0 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | True |
| Deep Smiles | [O-]C=O)CCC=O)[O-]))O.[K+].[K+] |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Hydroxy acids and derivatives |
| Classyfire Subclass | Beta hydroxy acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 118.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | dipotassium, 2-hydroxybutanedioate |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Gsk 4 400 Rule | True |
| Molecular Formula | C4H4K2O5 |
| Inchi Key | SVICABYXKQIXBM-UHFFFAOYSA-L |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | dipotassium malate, potassium malate |
| Esol Class | Very soluble |
| Functional Groups | CC(=O)[O-], CO, [K+] |
| Compound Name | Dipotassium malate |
| Exact Mass | 209.933 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 209.933 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 210.27 |
| Gi Absorption | False |
| Covalent Unit Count | 3.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C4H6O5.2K/c5-2(4(8)9)1-3(6)7, , /h2,5H,1H2,(H,6,7)(H,8,9), , /q, 2*+1/p-2 |
| Smiles | C(C(C(=O)[O-])O)C(=O)[O-].[K+].[K+] |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
- 1. Outgoing r'ship
FOUND_INto/from Acmella Oleracea (Plant) Rel Props:Reference:ISBN:9780387706375 - 2. Outgoing r'ship
FOUND_INto/from Hovenia Dulcis (Plant) Rel Props:Reference:ISBN:9780387706375