(1R,5R,6R,13S,21R)-13-(3,4-dihydroxy-5-methylphenyl)-5-(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol
PubChem CID: 163088345
Connections displayed (default: 10).
Loading graph...
| Topological Polar Surface Area | 210.0 |
|---|---|
| Hydrogen Bond Donor Count | 9.0 |
| Inchi Key | DWMJRBXZWVVPDB-UYVQOXPASA-N |
| Rotatable Bond Count | 2.0 |
| Synonyms | (+)-Proanthocyanidin A2, EC-(4b,8)(2b,7)-EC, Epicatechin-(2b->7,4b->8)-epicatechin, Epicatechin-(2beta->7,4beta->8)-epicatechin, Proanthocyanidin A-2, Proanthocyanidin A2, Procyanidin A2, Procyanidin dimer A2, Procyanidoepicatechin, Procyanidol A2 |
| Heavy Atom Count | 43.0 |
| Compound Name | (1R,5R,6R,13S,21R)-13-(3,4-dihydroxy-5-methylphenyl)-5-(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol |
| Description | Isolated from cassia bark (Cinnamomum aromaticum). Proanthocyanidin A2 is found in many foods, some of which are herbs and spices, cinnamon, avocado, and lingonberry. |
| Exact Mass | 590.142 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 590.142 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1020.0 |
| Hydrogen Bond Acceptor Count | 12.0 |
| Molecular Weight | 590.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | (1R,5R,6R,13S,21R)-13-(3,4-dihydroxy-5-methylphenyl)-5-(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C31H26O12/c1-11-4-13(6-20(37)27(11)39)31-30(40)26(24-19(36)7-14(32)8-22(24)42-31)25-23(43-31)10-17(34)15-9-21(38)28(41-29(15)25)12-2-3-16(33)18(35)5-12/h2-8,10,21,26,28,30,32-40H,9H2,1H3/t21-,26-,28-,30-,31+/m1/s1 |
| Smiles | CC1=CC(=CC(=C1O)O)[C@]23[C@@H]([C@H](C4=C(C=C(C=C4O2)O)O)C5=C(O3)C=C(C6=C5O[C@@H]([C@@H](C6)O)C7=CC(=C(C=C7)O)O)O)O |
| Xlogp | 2.8 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C31H26O12 |
- 1. Outgoing r'ship
FOUND_INto/from Arachis Hypogaea (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Cinnamomum Aromaticum (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Cinnamomum Verum (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Malus Domestica (Plant) Rel Props:Source_db:fooddb_chem_all - 5. Outgoing r'ship
FOUND_INto/from Persea Americana (Plant) Rel Props:Source_db:fooddb_chem_all