Malabaricone B
PubChem CID: 163001
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Malabaricone B, 63335-24-0, 1-(2,6-dihydroxyphenyl)-9-(4-hydroxyphenyl)nonan-1-one, DTXSID80212720, NSC630196, NSC 287967, 1-Nonanone, 1-(2,6-dihydroxyphenyl)-9-(4-hydroxyphenyl)-, 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone, Malabaricon-B, 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone, 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)nonan-1-one, NSC 287967, NSC 630196, CHEMBL489354, DTXCID10135211, HY-N8517, BDBM50182486, NSC287967, AKOS040763674, NSC-287967, NSC-630196, DA-65204, MS-25245, XM172957, CS-0145502, E88737 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 77.8 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC(CCCCCCCCC1CCCCC1)C1CCCCC1 |
| Np Classifier Class | Catechols with side chains |
| Deep Smiles | Occcccc6))CCCCCCCCC=O)ccO)cccc6O |
| Heavy Atom Count | 25.0 |
| Classyfire Class | Organooxygen compounds |
| Scaffold Graph Node Level | OC(CCCCCCCCC1CCCCC1)C1CCCCC1 |
| Classyfire Subclass | Carbonyl compounds |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 366.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P81908, P22303, P62575, P00690, P02769, Q86VZ5, Q8NHU3 |
| Iupac Name | 1-(2,6-dihydroxyphenyl)-9-(4-hydroxyphenyl)nonan-1-one |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Class | Organooxygen compounds |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Target Id | NPT204 |
| Xlogp | 6.0 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbonyl compounds |
| Gsk 4 400 Rule | False |
| Molecular Formula | C21H26O4 |
| Scaffold Graph Node Bond Level | O=C(CCCCCCCCc1ccccc1)c1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | KOAPDMKKECXPHX-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.3809523809523809 |
| Logs | -3.367 |
| Rotatable Bond Count | 10.0 |
| Logd | 4.136 |
| Synonyms | malabaricone b |
| Esol Class | Moderately soluble |
| Functional Groups | cC(C)=O, cO |
| Compound Name | Malabaricone B |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 342.183 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 342.183 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 342.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -5.469797 |
| Inchi | InChI=1S/C21H26O4/c22-17-14-12-16(13-15-17)8-5-3-1-2-4-6-9-18(23)21-19(24)10-7-11-20(21)25/h7,10-15,22,24-25H,1-6,8-9H2 |
| Smiles | C1=CC(=C(C(=C1)O)C(=O)CCCCCCCCC2=CC=C(C=C2)O)O |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Alkyl-phenylketones |
| Np Classifier Superclass | Aromatic polyketides |
- 1. Outgoing r'ship
FOUND_INto/from Acronychia Vestita (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Aquilegia Fragrans (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Artemisia Vestita (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Asclepias Asthmatica (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Asclepias Curassavica (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Asclepias Eriocarpa (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Asclepias Gigantea (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Asclepias Incarnata (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Asclepias Speciosa (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Asclepias Subulata (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Asclepias Syriaca (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Asclepias Tuberosa (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Asclepias Vestita (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Asclepias Vomitoria (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Cheilanthes Fragrans (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Chimonanthus Fragrans (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Chonemorpha Fragrans (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Clausena Vestita (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Clerodendron Fragrans (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Fagraea Fragrans (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Heteropanax Fragrans (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Klasea Sogdiana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 23. Outgoing r'ship
FOUND_INto/from Mannia Fragrans (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Myristica Andamanica (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Myristica Argentea (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Myristica Cagayanensis (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Myristica Dactyloides (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Myristica Fragrans (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 29. Outgoing r'ship
FOUND_INto/from Myristica Gigantea (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Myristica Malabarica (Plant) Rel Props:Reference:ISBN:9770972795006 - 31. Outgoing r'ship
FOUND_INto/from Myristica Officinalis (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Myristica Otoba (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Osmanthus Fragrans (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Pelargonium Fragrans (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Polyalthia Fragrans (Plant) Rel Props:Reference: - 36. Outgoing r'ship
FOUND_INto/from Shuteria Involucrata (Plant) Rel Props:Reference: - 37. Outgoing r'ship
FOUND_INto/from Thunbergia Fragrans (Plant) Rel Props:Reference: - 38. Outgoing r'ship
FOUND_INto/from Tillandsia Fragrans (Plant) Rel Props:Reference: - 39. Outgoing r'ship
FOUND_INto/from Vicoa Vestita (Plant) Rel Props:Reference: