(3S,3aS,4R,5E,7S,11aS)-4-hydroxy-3,6,10-trimethyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one
PubChem CID: 162951088
Connections displayed (default: 10).
Loading graph...
| Topological Polar Surface Area | 146.0 |
|---|---|
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | HAJGGPOOUMMUSU-INNWQQSOSA-N |
| Rotatable Bond Count | 3.0 |
| Synonyms | (+)-Cichorioside M |
| Heavy Atom Count | 30.0 |
| Compound Name | (3S,3aS,4R,5E,7S,11aS)-4-hydroxy-3,6,10-trimethyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one |
| Description | Cichorioside m is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Cichorioside m can be found in endive, which makes cichorioside m a potential biomarker for the consumption of this food product. |
| Exact Mass | 428.205 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 428.205 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 690.0 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 428.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 10.0 |
| Iupac Name | (3S,3aS,4R,5E,7S,11aS)-4-hydroxy-3,6,10-trimethyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one |
| Total Atom Stereocenter Count | 10.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 2.0 |
| Inchi | InChI=1S/C21H32O9/c1-9-4-5-13(29-21-19(26)18(25)17(24)15(8-22)30-21)10(2)7-12(23)16-11(3)20(27)28-14(16)6-9/h4,7,11-19,21-26H,5-6,8H2,1-3H3/b9-4?,10-7+/t11-,12+,13-,14-,15+,16-,17+,18-,19+,21+/m0/s1 |
| Smiles | C[C@H]1[C@@H]2[C@H](CC(=CC[C@@H](/C(=C/[C@H]2O)/C)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C)OC1=O |
| Xlogp | -0.7 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C21H32O9 |
- 1. Outgoing r'ship
FOUND_INto/from Cichorium Endivia (Plant) Rel Props:Source_db:fooddb_chem_all