Psoberan
PubChem CID: 162699
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Psoberan, furo[3,2-g]chromen-7-one, 4-methoxyfuro[3,2-g]chromen-7-one, Psorberan, Psoralen & Bergapten, 7H-Furo(3,2-g)(1)benzopyran-7-one, 4-methoxy-, mixt. with 7H-furo(3,2-g)(1)benzopyran-7-one, DTXSID90967279, furo[3,2-g]chromen-7-one, 4-methoxyfuro[3,2-g]chromen-7-one, 7H-Furo[3,2-g][1]benzopyran-7-one--4-methoxy-7H-furo[3,2-g][1]benzopyran-7-one (1/1) |
|---|---|
| Topological Polar Surface Area | 88.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | IAMQACMBFNNMJC-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | Psoralen & bergapten, Psorberan |
| Heavy Atom Count | 30.0 |
| Compound Name | Psoberan |
| Kingdom | Organic compounds |
| Description | Psoberan can be found in fig, which makes psoberan a potential biomarker for the consumption of this food product. |
| Exact Mass | 402.074 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 402.074 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 609.0 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 402.4 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 2.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | furo[3,2-g]chromen-7-one, 4-methoxyfuro[3,2-g]chromen-7-one |
| Total Atom Stereocenter Count | 0.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Class | Coumarins and derivatives |
| Inchi | InChI=1S/C12H8O4.C11H6O3/c1-14-12-7-2-3-11(13)16-10(7)6-9-8(12)4-5-15-9, 12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h2-6H,1H3, 1-6H |
| Smiles | COC1=C2C=CC(=O)OC2=CC3=C1C=CO3.C1=CC(=O)OC2=CC3=C(C=CO3)C=C21 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Furanocoumarins |
| Taxonomy Direct Parent | 5-methoxypsoralens |
| Molecular Formula | C23H14O7 |
- 1. Outgoing r'ship
FOUND_INto/from Ficus Carica (Plant) Rel Props:Source_db:fooddb_chem_all