Asiaticoside A
PubChem CID: 161823
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Madecassoside, 34540-22-2, ASIATICOSIDE A, [6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] 8,10,11-trihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate, Hydroxyasiaticoside, Madecassoside (Standard), SCHEMBL8816653, HY-N0568R, HY-N0568, AKOS032962019, CS-5832, LS-15484, DB-048641, NS00120452, [6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl)oxy-tetrahydropyran-2-yl]oxymethyl]-3,4,5-trihydroxy-tetrahydropyran-2-yl] 8,10,11-trihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
|---|---|
| Topological Polar Surface Area | 335.0 |
| Hydrogen Bond Donor Count | 13.0 |
| Heavy Atom Count | 68.0 |
| Description | Isolated from whole plants of Centella asiatica (Ji Xue Cao). Madecassoside is found in green vegetables. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1860.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] 8,10,11-trihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Class | Prenol lipids |
| Xlogp | -1.2 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Terpene glycosides |
| Molecular Formula | C48H78O20 |
| Prediction Swissadme | 0.0 |
| Inchi Key | BNMGUJRJUUDLHW-UHFFFAOYSA-N |
| Fcsp3 | 0.9375 |
| Logs | -1.856 |
| Rotatable Bond Count | 10.0 |
| State | Solid |
| Logd | 0.766 |
| Synonyms | Asiaticoside A, Madecassoside, Asiaticoside a, 6-({[3,4-dihydroxy-6-(hydroxymethyl)-5-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl 8,10,11-trihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylic acid |
| Compound Name | Asiaticoside A |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 974.509 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 974.509 |
| Hydrogen Bond Acceptor Count | 20.0 |
| Molecular Weight | 975.1 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 28.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Esol | -4.444618400000005 |
| Inchi | InChI=1S/C48H78O20/c1-19-10-11-48(13-12-46(6)22(28(48)20(19)2)8-9-27-44(4)14-24(52)39(61)45(5,18-50)38(44)23(51)15-47(27,46)7)43(62)68-42-35(59)32(56)30(54)26(66-42)17-63-40-36(60)33(57)37(25(16-49)65-40)67-41-34(58)31(55)29(53)21(3)64-41/h8,19-21,23-42,49-61H,9-18H2,1-7H3 |
| Smiles | CC1CCC2(CCC3(C(=CCC4C3(CC(C5C4(CC(C(C5(C)CO)O)O)C)O)C)C2C1C)C)C(=O)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)O)O)O)O |
| Nring | 8.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Triterpene saponins |
- 1. Outgoing r'ship
FOUND_INto/from Barringtonia Asiatica (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Berberis Asiatica (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Buddleja Asiatica (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Centella Asiatica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Chomelia Asiatica (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Colubrina Asiatica (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Gmelina Asiatica (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Grewia Asiatica (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Leea Asiatica (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Malus Asiatica (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Plantago Asiatica (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Striga Asiatica (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Tarenna Asiatica (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Tetracera Asiatica (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Toddalia Asiatica (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Torenia Asiatica (Plant) Rel Props:Reference: