Myricanone
PubChem CID: 161748
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Myricanone, 32492-74-3, 3,15-dihydroxy-16,17-dimethoxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one, 3,15-Dihydroxy-16,17-dimethoxytricyclo[12.3.1.12,6]nonadeca-1(18),2,4,6(19),14,16-hexaen-9-one, SCHEMBL432252, CHEMBL2152655, DTXSID60186218, CHEBI:141540, ZTSNTUQTNQSIDC-UHFFFAOYSA-N, HBA49274, HY-N3223, AKOS032948800, FS-9754, Tricyclo(12.3.1.12,6)nonadeca-1(18),2,4,6(19),14,16-hexaen-9-one, 3,15-dihydroxy-16,17-dimethoxy-, Q15634107, 14,26-Dihydroxy-15,16-dimethoxy-1,2(1,3)-dibenzenacyclononaphan-5-one, 3,15-dihydroxy-16,17-dimethoxytricyclo[12.3.1.1^{2,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one, 3,15-dihydroxy-16,17-dimethoxytricyclo[12.3.1.1^{2,6}]nonadeca-1(18),2(19),3,5,14,16-hexaen-9-one |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 76.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCCCC2CCCC(C2)C2CCCC(CC1)C2 |
| Np Classifier Class | Biaryl type diarylheptanoids |
| Deep Smiles | COcc-cccCCC=O)CCCCcc%13)cc%15OC)))O))))))))))ccc6O |
| Heavy Atom Count | 26.0 |
| Classyfire Class | Diarylheptanoids |
| Scaffold Graph Node Level | OC1CCCCC2CCCC(C2)C2CCCC(CC1)C2 |
| Classyfire Subclass | Cyclic diarylheptanoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 467.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | n.a. |
| Iupac Name | 3,15-dihydroxy-16,17-dimethoxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 3.7 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C21H24O5 |
| Scaffold Graph Node Bond Level | O=C1CCCCc2cccc(c2)-c2cccc(c2)CC1 |
| Prediction Swissadme | 1.0 |
| Inchi Key | ZTSNTUQTNQSIDC-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.3809523809523809 |
| Logs | -4.283 |
| Rotatable Bond Count | 2.0 |
| Logd | 2.912 |
| Synonyms | myricanone |
| Esol Class | Moderately soluble |
| Functional Groups | CC(C)=O, cO, cOC |
| Compound Name | Myricanone |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 356.162 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 356.162 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 356.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.558830061538462 |
| Inchi | InChI=1S/C21H24O5/c1-25-20-17-12-14(19(24)21(20)26-2)5-3-4-6-15(22)9-7-13-8-10-18(23)16(17)11-13/h8,10-12,23-24H,3-7,9H2,1-2H3 |
| Smiles | COC1=C2C=C(CCCCC(=O)CCC3=CC2=C(C=C3)O)C(=C1OC)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Diarylheptanoids |
- 1. Outgoing r'ship
FOUND_INto/from Basella Rubra (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Euphrasia Rubra (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Garcinia Morella (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Morella Cerifera (Plant) Rel Props:Reference:ISBN:9770972795006 - 5. Outgoing r'ship
FOUND_INto/from Morella Pensylvanica (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Morella Rubra (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Morus Rubra (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Myrica Arborea (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Myrica Cerifera (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Myrica Esculenta (Plant) Rel Props:Reference:ISBN:9788171360536; ISBN:9788172363130; ISBN:9788185042084; ISBN:9788185042114; ISBN:9788185042138; ISBN:9788185042145 - 11. Outgoing r'ship
FOUND_INto/from Myrica Gale (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Myrica Multiflora (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Myrica Nagi (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Myrica Nana (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Nectandra Rubra (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Nymphaea Rubra (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Odontites Rubra (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Plumeria Rubra (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Quercus Rubra (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Rosa Rubra (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Sextonia Rubra (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Spergularia Rubra (Plant) Rel Props:Reference: