Methylarsonite
PubChem CID: 161491
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | methylarsonous acid, Methanearsonous acid, Methylarsonite, monomethylarsonous acid, 25400-23-1, MMAIII, Arsonous acid, methyl-, methyl Arsonous acid, CCRIS 9323, MeAs(OH)2, CHEBI:17826, DTXSID60180059, CHEBI:14597, Methanearsonous Acid, Methylarsonous Acid, MMA(III), CHEMBL4097463, DTXCID20102550, C07295, Q27102648 |
|---|---|
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 4.0 |
| Description | Methylarsonite is found in the arsenate detoxification I pathway. Two molecules of glutathione reacts with methylarsonate to produce glutathione disulfide and methylarsonite. Methylarsonate reductase catalyzes this reaction. Methylarsonite reacts with S-adenosyl-L-methionine to produce S-adenosyl-L-homocysteine and dimethylarsinate. Methylarsonite methyltransferase catalyzes this reaction. [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 13.5 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Enzyme Uniprot Id | P78417, Q9H4Y5 |
| Iupac Name | methylarsonous acid |
| Prediction Hob | 1.0 |
| Molecular Formula | CH5AsO2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | OXBIRPQQKCQWGV-UHFFFAOYSA-N |
| Fcsp3 | 1.0 |
| Logs | -1.145 |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Logd | -0.625 |
| Synonyms | MeAs(OH)2, Methanearsonous acid, methyl Arsonous acid, Methylarsonous acid, Mma(III), MmaIII, Monomethylarsonous acid |
| Compound Name | Methylarsonite |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 123.951 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 123.951 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 123.971 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/CH5AsO2/c1-2(3)4/h3-4H,1H3 |
| Smiles | C[As](O)O |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Curcuma Longa (Plant) Rel Props:Source_db:cmaup_ingredients