Liquidambar styraciflua
PubChem CID: 16133892
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Gallotannin, Glycerite, Gallotannic acid, Acid, tannic, FEMA No. 3042, Acide tannique, d'Acide tannique, Tannin from mimosa, Tannin from chestnut, Tannin from quebracho, Caswell No. 819, Liquidambar styraciflua, Tannic acid and tannins, Acacia mollissima tannin, Acide tannique [French], 28F9E0DJY6, Schinopsis lorentzii tannin, Tannic acid [USP:JAN], d'Acide tannique [French], Castanea sativa Mill tannin, Tannic acid (Quercus spp.), UNII-28F9E0DJY6, CCRIS 571, Chestnut tannin, Mimosa tannin, HSDB 831, Quebracho tannin, EINECS 215-753-2, Tannic acid, Tannin, EPA Pesticide Chemical Code 078502, NSC 656273, Hydrolyzable gallotannin, SCHEMBL17432880, LRBQNJMCXXYXIU-QWKBTXIPSA-N |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 778.0 |
| Hydrogen Bond Donor Count | 25.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC(CC1CCCC(C(C)CCC2CC(CC(C)C3CCCC(CC(C)C4CCCCC4)C3)C(CC(C)C3CCCC(CC(C)C4CCCCC4)C3)C(CC(C)C3CCCC(CC(C)C4CCCCC4)C3)C2CC(C)C2CCCC(CC(C)C3CCCCC3)C2)C1)C1CCCCC1 |
| Np Classifier Class | Depsides |
| Deep Smiles | O=CcccO)ccc6)OC=O)cccO)ccc6)O))O))))))))O)))))O[C@H][C@H]COC=O)cccO)ccc6)OC=O)cccO)ccc6)O))O))))))))O))))))))O[C@@H][C@H][C@@H]6OC=O)cccO)ccc6)OC=O)cccO)ccc6)O))O))))))))O))))))))OC=O)cccO)ccc6)OC=O)cccO)ccc6)O))O))))))))O))))))))OC=O)cccO)ccc6)OC=O)cccO)ccc6)O))O))))))))O |
| Heavy Atom Count | 122.0 |
| Classyfire Class | Tannins |
| Scaffold Graph Node Level | OC(OCC1OC(OC(O)C2CCCC(OC(O)C3CCCCC3)C2)C(OC(O)C2CCCC(OC(O)C3CCCCC3)C2)C(OC(O)C2CCCC(OC(O)C3CCCCC3)C2)C1OC(O)C1CCCC(OC(O)C2CCCCC2)C1)C1CCCC(OC(O)C2CCCCC2)C1 |
| Classyfire Subclass | Hydrolyzable tannins |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 3570.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | [2,3-dihydroxy-5-[[(2S,3S,4R,5S,6R)-3,4,5,6-tetrakis[[3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoyl]oxy]oxan-2-yl]methoxycarbonyl]phenyl] 3,4,5-trihydroxybenzoate |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 6.2 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C76H52O46 |
| Scaffold Graph Node Bond Level | O=C(OCC1OC(OC(=O)c2cccc(OC(=O)c3ccccc3)c2)C(OC(=O)c2cccc(OC(=O)c3ccccc3)c2)C(OC(=O)c2cccc(OC(=O)c3ccccc3)c2)C1OC(=O)c1cccc(OC(=O)c2ccccc2)c1)c1cccc(OC(=O)c2ccccc2)c1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | LRBQNJMCXXYXIU-QWKBTXIPSA-N |
| Fcsp3 | 0.0789473684210526 |
| Logs | 0.258 |
| Rotatable Bond Count | 31.0 |
| Logd | 2.183 |
| Synonyms | gallotannic acid, gallotannic-acid |
| Functional Groups | cC(=O)OC, cC(=O)O[C@H](C)OC, cO, cOC(c)=O |
| Compound Name | Liquidambar styraciflua |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 1700.17 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 1700.17 |
| Hydrogen Bond Acceptor Count | 46.0 |
| Molecular Weight | 1701.2 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Esol | -12.611411626229515 |
| Inchi | InChI=1S/C76H52O46/c77-32-1-22(2-33(78)53(32)92)67(103)113-47-16-27(11-42(87)58(47)97)66(102)112-21-52-63(119-72(108)28-12-43(88)59(98)48(17-28)114-68(104)23-3-34(79)54(93)35(80)4-23)64(120-73(109)29-13-44(89)60(99)49(18-29)115-69(105)24-5-36(81)55(94)37(82)6-24)65(121-74(110)30-14-45(90)61(100)50(19-30)116-70(106)25-7-38(83)56(95)39(84)8-25)76(118-52)122-75(111)31-15-46(91)62(101)51(20-31)117-71(107)26-9-40(85)57(96)41(86)10-26/h1-20,52,63-65,76-101H,21H2/t52-,63-,64+,65-,76+/m0/s1 |
| Smiles | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OC[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O |
| Nring | 11.0 |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Aromatic polyketides |
- 1. Outgoing r'ship
FOUND_INto/from Albizia Julibrissin (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Bistorta Officinalis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Citrus Wilsonii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Desmodium Styracifolium (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Echinacea Purpurea (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Folium Digitalis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Gleditsia Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Hibiscus Syriacus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Ilex Pubescens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Ilex Rotunda (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Lemna Minor (Plant) Rel Props:Source_db:npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Picrorhiza Kurrooa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Piper Wallichii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Potentilla Discolor (Plant) Rel Props:Source_db:npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Pteris Multifida (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Quercus Infectoria (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 17. Outgoing r'ship
FOUND_INto/from Sambucus Williamsii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Sargentodoxa Cuneata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Selaginella Tamariscina (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Swertia Hickinii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 21. Outgoing r'ship
FOUND_INto/from Syzygium Aromaticum (Plant) Rel Props:Reference:ISBN:9788172361150 - 22. Outgoing r'ship
FOUND_INto/from Thalictrum Foliolosum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 23. Outgoing r'ship
FOUND_INto/from Trachycarpus Fortunei (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all