Protokosin
PubChem CID: 160914
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Protokosin, 10091-70-0, 1-[3-[[2,6-dihydroxy-4-methoxy-3-methyl-5-(2-methylpropanoyl)phenyl]methyl]-2,4,6-trihydroxy-5-[[2-hydroxy-4,6-dimethoxy-3-methyl-5-(2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one, 1-Propanone, 1-(3-((2,6-dihydroxy-4-methoxy-3-methyl-5-(2-methyl-1-oxopropyl)phenyl)methyl)-2,4,6-trihydroxy-5-((2-hydroxy-4,6-dimethoxy-3-methyl-5-(2-methyl-1-oxopropyl)phenyl)methyl)phenyl)-2-methyl-, 1-(3-{[2,6-Dihydroxy-4-methoxy-3-methyl-5-(2-methylpropanoyl)phenyl]methyl}-2,4,6-trihydroxy-5-{[2-hydroxy-4,6-dimethoxy-3-methyl-5-(2-methylpropanoyl)phenyl]methyl}phenyl)-2-methylpropan-1-one, DTXSID30905837, 1-[3-[[2,6-dihydroxy-4-methoxy-3-methyl-5-(2-methyl-1-oxopropyl)phenyl]methyl]-2,4,6-trihydroxy-5-[[2-hydroxy-4,6-dimethoxy-3-methyl-5-(2-methyl-1-oxopropyl)-phenyl]methyl]phenyl]-2-methyl-1-propanone |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 200.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC(CC2CCCC(CC3CCCCC3)C2)CC1 |
| Np Classifier Class | Oligomeric phloroglucinols (phlorotannins) |
| Deep Smiles | COccC)cO)ccc6C=O)CC)C))))O))CccO)cCccO)cC)ccc6OC)))C=O)CC)C))))OC)))))))ccc6O))C=O)CC)C))))O |
| Heavy Atom Count | 49.0 |
| Classyfire Class | Diarylheptanoids |
| Scaffold Graph Node Level | C1CCC(CC2CCCC(CC3CCCCC3)C2)CC1 |
| Classyfire Subclass | Linear diarylheptanoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1130.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1-[3-[[2,6-dihydroxy-4-methoxy-3-methyl-5-(2-methylpropanoyl)phenyl]methyl]-2,4,6-trihydroxy-5-[[2-hydroxy-4,6-dimethoxy-3-methyl-5-(2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 7.6 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C37H46O12 |
| Scaffold Graph Node Bond Level | c1ccc(Cc2cccc(Cc3ccccc3)c2)cc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | KZRUJLHMLWGQQL-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.4324324324324324 |
| Logs | -3.956 |
| Rotatable Bond Count | 13.0 |
| Logd | 2.193 |
| Synonyms | protokosin |
| Esol Class | Poorly soluble |
| Functional Groups | cC(C)=O, cO, cOC |
| Compound Name | Protokosin |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 682.299 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 682.299 |
| Hydrogen Bond Acceptor Count | 12.0 |
| Molecular Weight | 682.8 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Esol | -8.249767334693878 |
| Inchi | InChI=1S/C37H46O12/c1-14(2)26(38)23-32(44)20(12-19-29(41)17(7)35(47-9)24(34(19)46)27(39)15(3)4)31(43)21(33(23)45)13-22-30(42)18(8)36(48-10)25(37(22)49-11)28(40)16(5)6/h14-16,41-46H,12-13H2,1-11H3 |
| Smiles | CC1=C(C(=C(C(=C1OC)C(=O)C(C)C)O)CC2=C(C(=C(C(=C2O)C(=O)C(C)C)O)CC3=C(C(=C(C(=C3O)C)OC)C(=O)C(C)C)OC)O)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Phloroglucinols |
- 1. Outgoing r'ship
FOUND_INto/from Agave Americana (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Brunfelsia Americana (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Cordia Americana (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Erythrina Americana (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Genipa Americana (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Hagenia Abyssinica (Plant) Rel Props:Reference:ISBN:9788172360481; ISBN:9788172361266; ISBN:9788172362300; ISBN:9788185042145 - 7. Outgoing r'ship
FOUND_INto/from Mammea Africana (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Mammea Americana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Mammea Longifolia (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Mammea Siamensis (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Mammea Suriga (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Persea Americana (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Phytolacca Americana (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Ulmus Americana (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Waltheria Americana (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Ximenia Americana (Plant) Rel Props:Reference: