Maesopsin
PubChem CID: 160803
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Maesopsin, 5989-16-2, Mesopsin, 2,4,6-trihydroxy-2-[(4-hydroxyphenyl)methyl]-1-benzofuran-3-one, 3(2H)-Benzofuranone, 2,4,6-trihydroxy-2-((4-hydroxyphenyl)methyl)-, 2,4,6-trihydroxy-2-((4-hydroxyphenyl)methyl)-1-benzofuran-3-one, CHEMBL462109, SCHEMBL9957960, DTXSID90975298, CHEBI:181507, FAA98916, LMPK12130072, AKOS040734675, Maesopsin, >=90% (LC/MS-ELSD), DA-75247, FS-10633, NS00097358, C22553, G89026, 2,4,6-trihydroxy-2-[(4-hydroxyphenyl)methyl]-1-benzouran-3-one, 2,4,6-Trihydroxy-2-[(4-hydroxyphenyl)methyl]-1-benzofuran-3(2H)-one |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 107.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1C(CC2CCCCC2)CC2CCCCC21 |
| Np Classifier Class | Aurones |
| Deep Smiles | Occcccc6))CCO)OccC5=O))cO)ccc6)O |
| Heavy Atom Count | 21.0 |
| Classyfire Class | Aurone flavonoids |
| Scaffold Graph Node Level | OC1C(CC2CCCCC2)OC2CCCCC21 |
| Classyfire Subclass | Auronols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 405.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,4,6-trihydroxy-2-[(4-hydroxyphenyl)methyl]-1-benzofuran-3-one |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 2.2 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H12O6 |
| Scaffold Graph Node Bond Level | O=C1c2ccccc2OC1Cc1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | LOFYFDPXORJJEE-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.1333333333333333 |
| Logs | -2.914 |
| Rotatable Bond Count | 2.0 |
| Logd | 1.942 |
| Synonyms | maesopsin |
| Esol Class | Soluble |
| Functional Groups | CC1(O)OccC1=O, cO |
| Compound Name | Maesopsin |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 288.063 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 288.063 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 288.25 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.2914381428571433 |
| Inchi | InChI=1S/C15H12O6/c16-9-3-1-8(2-4-9)7-15(20)14(19)13-11(18)5-10(17)6-12(13)21-15/h1-6,16-18,20H,7H2 |
| Smiles | C1=CC(=CC=C1CC2(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Castanospermum Australe (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Combretum Nanum (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Incarvillea Emodi (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Iochroma Australe (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Leontopodium Nanum (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Paeonia Emodi (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Podophyllum Emodi (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Polygala Emodi (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Rhamnus Virgatus (Plant) Rel Props:Reference:ISBN:9788185042138 - 10. Outgoing r'ship
FOUND_INto/from Rheum Australe (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Rheum Coreanum (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Rheum Emodi (Plant) Rel Props:Source_db:npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Rheum Hotaoense (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Rheum Maximowiczii (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Rheum Moorcroftianum (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Rheum Nanum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Rheum Officinale (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Rheum Palmatum (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Rheum Qinlingense (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Rheum Rhaponticum (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Rheum Sp (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Rheum Spiciforme (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Rheum Tanguticum (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Rheum Undulatum (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Rheum Webbianum (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Rheum Wittrocki (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Sinopodophyllum Emodi (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Trigonella Emodi (Plant) Rel Props:Reference: