Gypenoside XLIX
PubChem CID: 16007240
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Gypenoside XLIX, 94987-08-3, GypenosideXLIX, Gypenoside-XLIX, MFCD22124996, HY-N1990, s5151, AKOS030573598, CCG-270617, CCG-270618, OG32259, DA-63987, MS-31896, 1ST000844, CS-0018311 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 334.0 |
| Hydrogen Bond Donor Count | 12.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCC(CCCC2CCC3C2CCC2C4CCC(CC5CCCC(CC6CCCCC6)C5CC5CCCCC5)CC4CCC32)CC1 |
| Np Classifier Class | Dammarane and Protostane triterpenoids |
| Deep Smiles | OC[C@H]O[C@@H]OC[C@@][C@H]CC[C@@][C@@H]5CC[C@H][C@@]6C)CC[C@@H][C@]6C=O))CC[C@@H]C6C)C))O[C@@H]OC[C@@H][C@@H][C@H]6O[C@@H]O[C@@H]C)[C@@H][C@H][C@H]6O))O))O)))))))O[C@@H]OC[C@H][C@@H][C@H]6O))O))O)))))))O))))))))))))))))))C)))))CCC=CC)C)))))O))))[C@@H][C@H][C@@H]6O))O))O |
| Heavy Atom Count | 73.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | C1CCC(OCCC2CCC3C2CCC2C4CCC(OC5OCCC(OC6CCCCO6)C5OC5CCCCO5)CC4CCC32)OC1 |
| Classyfire Subclass | Terpene glycosides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1910.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 27.0 |
| Iupac Name | (3S,5S,8R,9S,10S,13R,14R,17S)-17-[(2S)-2-hydroxy-6-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-3-[(2S,3R,4S,5S)-5-hydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,4,8,14-tetramethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 0.4 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C52H86O21 |
| Scaffold Graph Node Bond Level | C1CCC(OCCC2CCC3C2CCC2C4CCC(OC5OCCC(OC6CCCCO6)C5OC5CCCCO5)CC4CCC32)OC1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | AFEVCSJFNQWWDF-AZFNEDKCSA-N |
| Fcsp3 | 0.9423076923076924 |
| Logs | -3.276 |
| Rotatable Bond Count | 15.0 |
| Logd | 1.75 |
| Synonyms | gypenoside xlix |
| Functional Groups | CC=C(C)C, CC=O, CO, CO[C@@H](C)OC, CO[C@H](C)OC |
| Compound Name | Gypenoside XLIX |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 1046.57 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 1046.57 |
| Hydrogen Bond Acceptor Count | 21.0 |
| Molecular Weight | 1047.2 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 27.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Esol | -5.5885818000000045 |
| Inchi | InChI=1S/C52H86O21/c1-24(2)9-8-15-52(65,23-68-45-40(63)38(61)36(59)30(19-53)70-45)27-12-16-49(6)26(27)10-11-32-50(49,7)17-13-31-48(4,5)33(14-18-51(31,32)22-54)71-47-43(73-46-41(64)37(60)34(57)25(3)69-46)42(29(56)21-67-47)72-44-39(62)35(58)28(55)20-66-44/h9,22,25-47,53,55-65H,8,10-21,23H2,1-7H3/t25-,26+,27-,28+,29-,30+,31-,32-,33-,34-,35-,36+,37+,38-,39+,40+,41+,42-,43+,44-,45+,46-,47-,49+,50+,51+,52+/m0/s1 |
| Smiles | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2O[C@H]3CC[C@@]4([C@H]5CC[C@@H]6[C@H](CC[C@]6([C@@]5(CC[C@H]4C3(C)C)C)C)[C@@](CCC=C(C)C)(CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)C=O)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O)O)O |
| Nring | 8.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Andrographis Alata (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Azolla Pinnata (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Boronia Alata (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Boronia Pinnata (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Canscora Alata (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Cardamine Pinnata (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Cassia Alata (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Chrysanthemum Myconis (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Coleostephus Myconis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Crotalaria Alata (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Dahlia Coccinea (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Dahlia Pinnata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Dahlstedtia Pinnata (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Dbergia Pinnata (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Dioscorea Alata (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Eucalyptus Alata (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Euphorbia Characias (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Garuga Pinnata (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Gynostemma Longipes (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Gynostemma Pentaphyllum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 21. Outgoing r'ship
FOUND_INto/from Gynostemma Yixingense (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Hardwickia Pinnata (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Kalanchoe Pinnata (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Kigelia Pinnata (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Laggera Alata (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Leea Alata (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Munronia Pinnata (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Murraya Alata (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Naregamia Alata (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Naringi Alata (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Onoseris Alata (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Paullinia Pinnata (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Pongamia Pinnata (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Pterygota Alata (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Quamoclit Pinnata (Plant) Rel Props:Reference: - 36. Outgoing r'ship
FOUND_INto/from Ruta Pinnata (Plant) Rel Props:Reference: - 37. Outgoing r'ship
FOUND_INto/from Sapondius Pinnata (Plant) Rel Props:Reference: - 38. Outgoing r'ship
FOUND_INto/from Schkuhria Pinnata (Plant) Rel Props:Reference: - 39. Outgoing r'ship
FOUND_INto/from Senna Alata (Plant) Rel Props:Reference: - 40. Outgoing r'ship
FOUND_INto/from Spondias Pinnata (Plant) Rel Props:Reference: - 41. Outgoing r'ship
FOUND_INto/from Swertia Alata (Plant) Rel Props:Reference: - 42. Outgoing r'ship
FOUND_INto/from Synotis Alata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all; Reference: - 43. Outgoing r'ship
FOUND_INto/from Terminalia Alata (Plant) Rel Props:Reference: - 44. Outgoing r'ship
FOUND_INto/from Thunbergia Alata (Plant) Rel Props:Reference: - 45. Outgoing r'ship
FOUND_INto/from Vitex Pinnata (Plant) Rel Props:Reference: