beta-Pyrufuran
PubChem CID: 159238
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | beta-Pyrufuran, 1,2,4-Trimethoxydibenzofuran-3-ol, 88256-04-6, 3-Dibenzofuranol, 1,2,4-trimethoxy-, 1,2,4-Trimethoxy-3-dibenzofuranol, b-Pyrufuran, .beta.-Pyrufuran, Trimethoxydibenzofuran-ol, C08948, CHEBI:10439, DTXSID80236926, XLCIGBDZQKRLPH-UHFFFAOYSA-N, 1,2,4-trimethoxy-dibenzofuran-3-ol, 1,2,4-Trimethoxydibenzo[b,d]furan-3-ol, 1,2,4-Trimethoxy-3-dibenzofuranol, 9CI, 1,2,4-Trimethoxydibenzo[b,d]furan-3-ol #, Q27108638, 3,4,6-trimethoxy-8-oxatricyclo[7.4.0.0^{2,7}]trideca-1(13),2,4,6,9,11-hexaen-5-ol |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 61.1 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CC1CCCCC12 |
| Deep Smiles | COccO)cOC))ccc6occ5cccc6)))))))))OC |
| Heavy Atom Count | 20.0 |
| Classyfire Class | Benzofurans |
| Description | Phytoalexin from Pyrus communis (pear). beta-Pyrufuran is found in pomes and pear. |
| Scaffold Graph Node Level | C1CCC2C(C1)OC1CCCCC12 |
| Classyfire Subclass | Dibenzofurans |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 336.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1,2,4-trimethoxydibenzofuran-3-ol |
| Nih Violation | False |
| Class | Benzofurans |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 3.2 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Subclass | Dibenzofurans |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H14O5 |
| Scaffold Graph Node Bond Level | c1ccc2c(c1)oc1ccccc12 |
| Inchi Key | XLCIGBDZQKRLPH-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 3.0 |
| Synonyms | 1,2,4-Trimethoxy-3-dibenzofuranol, 1,2,4-Trimethoxy-3-dibenzofuranol, 9CI, 1,2,4-Trimethoxydibenzofuran-3-ol, 3-Dibenzofuranol, 1,2,4-trimethoxy-, b-Pyrufuran, beta-Pyrufuran, Β-pyrufuran, 1,2,4-Trimethoxy-3-dibenzofuranol, 9ci, beta-pyrufuran |
| Esol Class | Soluble |
| Functional Groups | cO, cOC, coc |
| Compound Name | beta-Pyrufuran |
| Kingdom | Organic compounds |
| Exact Mass | 274.084 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 274.084 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 274.27 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C15H14O5/c1-17-12-10-8-6-4-5-7-9(8)20-13(10)15(19-3)11(16)14(12)18-2/h4-7,16H,1-3H3 |
| Smiles | COC1=C(C(=C(C2=C1C3=CC=CC=C3O2)OC)O)OC |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Dibenzofurans |
- 1. Outgoing r'ship
FOUND_INto/from Pyrus Communis (Plant) Rel Props:Source_db:fooddb_chem_all