(3S,5R,8S)-5,8-Epoxy-5,8-dihydro-beta,beta-caroten-3-ol
PubChem CID: 15847405
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (3S,5R,8S)-5,8-Epoxy-5,8-dihydro-beta,beta-caroten-3-ol |
|---|---|
| Topological Polar Surface Area | 29.5 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | DCWLOCNJVDYFMA-TWQKQLNXSA-N |
| Rotatable Bond Count | 9.0 |
| Heavy Atom Count | 42.0 |
| Compound Name | (3S,5R,8S)-5,8-Epoxy-5,8-dihydro-beta,beta-caroten-3-ol |
| Description | (3s,5r,8s)-5,8-epoxy-5,8-dihydro-beta,beta-caroten-3-ol is a member of the class of compounds known as xanthophylls. Xanthophylls are carotenoids containing an oxygenated carotene backbone. Carotenes are characterized by the presence of two end-groups (mostly cyclohexene rings, but also cyclopentene rings or acyclic groups) linked by a long branched alkyl chain. Carotenes belonging form a subgroup of the carotenoids family. Xanthophylls arise by oxygenation of the carotene backbone (3s,5r,8s)-5,8-epoxy-5,8-dihydro-beta,beta-caroten-3-ol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). (3s,5r,8s)-5,8-epoxy-5,8-dihydro-beta,beta-caroten-3-ol can be found in guava, which makes (3s,5r,8s)-5,8-epoxy-5,8-dihydro-beta,beta-caroten-3-ol a potential biomarker for the consumption of this food product. |
| Exact Mass | 568.428 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 568.428 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1290.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 568.9 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (2S,6S,7aR)-4,4,7a-trimethyl-2-[(2E,4E,6E,8E,10E,12E,14E,16E)-6,11,15-trimethyl-17-(2,6,6-trimethylcyclohexen-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-2,5,6,7-tetrahydro-1-benzofuran-6-ol |
| Total Atom Stereocenter Count | 3.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 8.0 |
| Inchi | InChI=1S/C40H56O2/c1-29(18-13-19-31(3)23-24-35-32(4)22-15-25-38(35,6)7)16-11-12-17-30(2)20-14-21-33(5)36-26-37-39(8,9)27-34(41)28-40(37,10)42-36/h11-14,16-21,23-24,26,34,36,41H,15,22,25,27-28H2,1-10H3/b12-11+,18-13+,20-14+,24-23+,29-16+,30-17+,31-19+,33-21+/t34-,36-,40+/m0/s1 |
| Smiles | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/[C@@H]2C=C3[C@](O2)(C[C@H](CC3(C)C)O)C)/C)/C |
| Xlogp | 11.3 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 8.0 |
| Molecular Formula | C40H56O2 |
- 1. Outgoing r'ship
FOUND_INto/from Psidium Guajava (Plant) Rel Props:Source_db:fooddb_chem_all