Malvidin 3-rhamnoside
PubChem CID: 157010087
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Malvidin 3-rhamnoside |
|---|---|
| Topological Polar Surface Area | 159.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | IBKIPCPWNULPMQ-UHFFFAOYSA-O |
| Rotatable Bond Count | 5.0 |
| Synonyms | Malvidin 3-rhamnoside |
| Heavy Atom Count | 34.0 |
| Compound Name | Malvidin 3-rhamnoside |
| Description | Malvidin 3-rhamnoside is a member of the class of compounds known as anthocyanidin-3-o-glycosides. Anthocyanidin-3-o-glycosides are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C3-position. Malvidin 3-rhamnoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Malvidin 3-rhamnoside can be found in common pea and grass pea, which makes malvidin 3-rhamnoside a potential biomarker for the consumption of these food products. |
| Exact Mass | 477.14 |
| Formal Charge | 1.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 477.14 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 653.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 477.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-6-methyloxane-3,4,5-triol |
| Total Atom Stereocenter Count | 5.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C23H24O11/c1-9-18(26)20(28)21(29)23(32-9)34-17-8-12-13(25)6-11(24)7-14(12)33-22(17)10-4-15(30-2)19(27)16(5-10)31-3/h4-9,18,20-21,23,26,28-29H,1-3H3,(H2-,24,25,27)/p+1 |
| Smiles | CC1C(C(C(C(O1)OC2=CC3=C(C=C(C=C3[O+]=C2C4=CC(=C(C(=C4)OC)O)OC)O)O)O)O)O |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C23H25O11+ |
- 1. Outgoing r'ship
FOUND_INto/from Lathyrus Sativus (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Pisum Sativum (Plant) Rel Props:Source_db:fooddb_chem_all