Cyanidin 3-(sinapoyl-xylosyl-glucosyl)-galactoside
PubChem CID: 157010042
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Cyanidin 3-(sinapoyl-xylosyl-glucosyl)-galactoside |
|---|---|
| Topological Polar Surface Area | 364.0 |
| Hydrogen Bond Donor Count | 13.0 |
| Inchi Key | LMVOIAASLVOPSW-BFROKHPDSA-O |
| Rotatable Bond Count | 16.0 |
| Heavy Atom Count | 67.0 |
| Compound Name | Cyanidin 3-(sinapoyl-xylosyl-glucosyl)-galactoside |
| Description | Cyanidin 3-(sinapoyl-xylosyl-glucosyl)-galactoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Cyanidin 3-(sinapoyl-xylosyl-glucosyl)-galactoside can be found in carrot and wild carrot, which makes cyanidin 3-(sinapoyl-xylosyl-glucosyl)-galactoside a potential biomarker for the consumption of these food products. |
| Exact Mass | 949.261 |
| Formal Charge | 1.0 |
| Monoisotopic Mass | 949.261 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1580.0 |
| Hydrogen Bond Acceptor Count | 23.0 |
| Molecular Weight | 949.8 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 14.0 |
| Iupac Name | [(2R,3R,4R,5R)-5-[[(2R,3S,4S,5R,6R)-6-[[(2R,3R,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-3,4-dihydroxyoxolan-2-yl]methyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
| Total Atom Stereocenter Count | 14.0 |
| Total Bond Stereocenter Count | 1.0 |
| Inchi | InChI=1S/C43H48O24/c1-58-24-7-16(8-25(59-2)31(24)49)3-6-30(48)60-13-27-34(52)37(55)41(65-27)61-14-28-32(50)35(53)38(56)42(66-28)62-15-29-33(51)36(54)39(57)43(67-29)64-26-12-19-21(46)10-18(44)11-23(19)63-40(26)17-4-5-20(45)22(47)9-17/h3-12,27-29,32-39,41-43,50-57H,13-15H2,1-2H3,(H4-,44,45,46,47,48,49)/p+1/t27-,28-,29-,32-,33+,34+,35+,36+,37-,38-,39-,41-,42-,43-/m1/s1 |
| Smiles | COC1=CC(=CC(=C1O)OC)/C=C/C(=O)OC[C@@H]2[C@@H]([C@H]([C@@H](O2)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC[C@@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)OC5=CC6=C(C=C(C=C6[O+]=C5C7=CC(=C(C=C7)O)O)O)O)O)O)O)O)O)O)O)O |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C43H49O24+ |
- 1. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Source_db:fooddb_chem_all