Isopropyl propyl trisulfide
PubChem CID: 157010036
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Isopropyl propyl trisulfide |
|---|---|
| Topological Polar Surface Area | 75.9 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | WXMVAYIYSNRPKO-UHFFFAOYSA-N |
| Rotatable Bond Count | 6.0 |
| Heavy Atom Count | 10.0 |
| Compound Name | Isopropyl propyl trisulfide |
| Description | Isopropyl propyl trisulfide is a member of the class of compounds known as organic trisulfides. Organic trisulfides are organosulfur compounds with the general formula RSSSR' (R,R'=alkyl, aryl). Isopropyl propyl trisulfide can be found in garden onion, which makes isopropyl propyl trisulfide a potential biomarker for the consumption of this food product. |
| Exact Mass | 196.041 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 196.041 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 63.9 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 196.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-methyl-1-(propyltrisulfanyl)propane |
| Total Atom Stereocenter Count | 0.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C7H16S3/c1-4-5-8-10-9-6-7(2)3/h7H,4-6H2,1-3H3 |
| Smiles | CCCSSSCC(C)C |
| Xlogp | 3.6 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C7H16S3 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Source_db:fooddb_chem_all