(-)-trans-Isomenth-5-en-2-ol
PubChem CID: 157010029
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (-)-trans-Isomenth-5-en-2-ol |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | HHDDWVZSUIVNQG-GUBZILKMSA-N |
| Rotatable Bond Count | 1.0 |
| Heavy Atom Count | 11.0 |
| Compound Name | (-)-trans-Isomenth-5-en-2-ol |
| Description | (-)-trans-isomenth-5-en-2-ol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). (-)-trans-isomenth-5-en-2-ol can be found in corn, which makes (-)-trans-isomenth-5-en-2-ol a potential biomarker for the consumption of this food product. |
| Exact Mass | 154.136 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 154.136 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 149.0 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 154.25 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (1S,2S,5S)-2-methyl-5-propan-2-ylcyclohex-3-en-1-ol |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-5,7-11H,6H2,1-3H3/t8-,9-,10-/m0/s1 |
| Smiles | C[C@H]1C=C[C@@H](C[C@@H]1O)C(C)C |
| Xlogp | 2.6 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C10H18O |
- 1. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:fooddb_chem_all