Acutissimin B
PubChem CID: 157009991
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Acutissimin B |
|---|---|
| Topological Polar Surface Area | 545.0 |
| Hydrogen Bond Donor Count | 20.0 |
| Inchi Key | IGVSILAHFPDUTO-BSBPBZKASA-N |
| Rotatable Bond Count | 2.0 |
| Heavy Atom Count | 87.0 |
| Compound Name | Acutissimin B |
| Description | Acutissimin b is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Acutissimin b can be found in guava, which makes acutissimin b a potential biomarker for the consumption of this food product. |
| Exact Mass | 1206.14 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 1206.14 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 2600.0 |
| Hydrogen Bond Acceptor Count | 31.0 |
| Molecular Weight | 1206.9 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (46R)-46-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-pentadecahydroxy-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone |
| Total Atom Stereocenter Count | 7.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C56H38O31/c57-15-2-1-10(3-16(15)58)48-21(63)4-11-22(83-48)8-17(59)27(35(11)64)32-31-34-30(44(73)47(76)45(31)74)29-33-28(42(71)46(75)43(29)72)26-14(7-20(62)38(67)41(26)70)53(78)84-23-9-82-52(77)12-5-18(60)36(65)39(68)24(12)25-13(6-19(61)37(66)40(25)69)54(79)85-49(23)51(87-56(33)81)50(32)86-55(34)80/h1-3,5-8,21,23,32,48-51,57-76H,4,9H2/t21-,23?,32-,48+,49?,50?,51?/m0/s1 |
| Smiles | C1[C@@H]([C@H](OC2=C1C(=C(C(=C2)O)[C@@H]3C4C5C6C(COC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O6)O)O)O)O)O)O)OC(=O)C9=CC(=C(C(=C9C1=C(C(=C(C(=C1O)O)O)C1=C(C3=C(C(=C1O)O)O)C(=O)O4)C(=O)O5)O)O)O)O)C1=CC(=C(C=C1)O)O)O |
| Xlogp | 3.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C56H38O31 |
- 1. Outgoing r'ship
FOUND_INto/from Psidium Guajava (Plant) Rel Props:Source_db:fooddb_chem_all