6beta-Hydroxystigmasta-4,22-dien-3-one
PubChem CID: 157009979
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 6beta-hydroxystigmasta-4,22-dien-3-one |
|---|---|
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | FFKIQLXJMQUBQZ-XEZOCEEZSA-N |
| Rotatable Bond Count | 5.0 |
| Heavy Atom Count | 31.0 |
| Compound Name | 6beta-Hydroxystigmasta-4,22-dien-3-one |
| Description | 6beta-hydroxystigmasta-4,22-dien-3-one is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 6beta-hydroxystigmasta-4,22-dien-3-one can be found in date, which makes 6beta-hydroxystigmasta-4,22-dien-3-one a potential biomarker for the consumption of this food product. |
| Exact Mass | 426.35 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 426.35 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 748.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 426.7 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | (6R,10R,13R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Total Atom Stereocenter Count | 9.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 1.0 |
| Inchi | InChI=1S/C29H46O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-17-27(31)26-16-21(30)12-14-29(26,6)25(22)13-15-28(23,24)5/h8-9,16,18-20,22-25,27,31H,7,10-15,17H2,1-6H3/b9-8+/t19-,20-,22?,23?,24?,25?,27-,28-,29-/m1/s1 |
| Smiles | CC[C@H](/C=C/[C@@H](C)C1CCC2[C@@]1(CCC3C2C[C@H](C4=CC(=O)CC[C@]34C)O)C)C(C)C |
| Xlogp | 7.2 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C29H46O2 |
- 1. Outgoing r'ship
FOUND_INto/from Phoenix Dactylifera (Plant) Rel Props:Source_db:fooddb_chem_all