p-Menthan-trans-2,5-diol
PubChem CID: 157009951
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | p-Menthan-trans-2,5-diol |
|---|---|
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | TXISQGBRDPUIBI-LGUIWLBCSA-N |
| Rotatable Bond Count | 1.0 |
| Heavy Atom Count | 12.0 |
| Compound Name | p-Menthan-trans-2,5-diol |
| Description | P-menthan-trans-2,5-diol is soluble (in water) and a very weakly acidic compound (based on its pKa). P-menthan-trans-2,5-diol can be found in cornmint, which makes P-menthan-trans-2,5-diol a potential biomarker for the consumption of this food product. |
| Exact Mass | 172.146 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 172.146 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 145.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 172.26 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (2R,5R)-2-methyl-5-propan-2-ylcyclohexane-1,4-diol |
| Total Atom Stereocenter Count | 4.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C10H20O2/c1-6(2)8-5-9(11)7(3)4-10(8)12/h6-12H,4-5H2,1-3H3/t7-,8-,9?,10?/m1/s1 |
| Smiles | C[C@@H]1CC([C@H](CC1O)C(C)C)O |
| Xlogp | 1.9 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C10H20O2 |
- 1. Outgoing r'ship
FOUND_INto/from Mentha Arvensis (Plant) Rel Props:Source_db:fooddb_chem_all