Kaurenoic acid thujanol ester
PubChem CID: 157009933
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Kaurenoic acid thujanol ester |
|---|---|
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | CMRBNBQSOJNLFB-AHPUQKNMSA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | (-)-ent-Kaur-16-en-19-oic-acid thujanol ester, 16-Kauren-19-oic acid thujanol ester, Cunabic acid thujanol ester, ent-Kaurenoic acid thujanol ester, Kaurenoic acid thujanol ester |
| Heavy Atom Count | 32.0 |
| Compound Name | Kaurenoic acid thujanol ester |
| Description | Kaurenoic acid thujanol ester is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Kaurenoic acid thujanol ester can be found in sunflower, which makes kaurenoic acid thujanol ester a potential biomarker for the consumption of this food product. |
| Exact Mass | 438.35 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 438.35 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 838.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 438.7 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | (4-methyl-1-propan-2-ylcyclohex-3-en-1-yl) (1S,4S,5R,9S,10R,13R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| Total Atom Stereocenter Count | 7.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C30H46O2/c1-20(2)30(16-10-21(3)11-17-30)32-26(31)28(6)14-7-13-27(5)24(28)12-15-29-18-22(4)23(19-29)8-9-25(27)29/h10,20,23-25H,4,7-9,11-19H2,1-3,5-6H3/t23-,24+,25+,27-,28-,29-,30?/m1/s1 |
| Smiles | CC1=CCC(CC1)(C(C)C)OC(=O)[C@@]2(CCC[C@@]3([C@@H]2CC[C@]45[C@H]3CC[C@H](C4)C(=C)C5)C)C |
| Xlogp | 8.4 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C30H46O2 |
- 1. Outgoing r'ship
FOUND_INto/from Helianthus Annuus (Plant) Rel Props:Source_db:fooddb_chem_all