Leucopelargonidin 3-O-alpha-L-rhamno-beta-D-glucopyranoside
PubChem CID: 157009923
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Leucopelargonidin 3-O-alpha-L-rhamno-beta-D-glucopyranoside |
|---|---|
| Topological Polar Surface Area | 248.0 |
| Hydrogen Bond Donor Count | 10.0 |
| Inchi Key | NODFKYJZPMLAJM-PATRHMBYSA-N |
| Rotatable Bond Count | 6.0 |
| Heavy Atom Count | 42.0 |
| Compound Name | Leucopelargonidin 3-O-alpha-L-rhamno-beta-D-glucopyranoside |
| Description | Leucopelargonidin 3-o-alpha-l-rhamno-beta-d-glucopyranoside is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Leucopelargonidin 3-o-alpha-l-rhamno-beta-d-glucopyranoside can be found in loquat, which makes leucopelargonidin 3-o-alpha-l-rhamno-beta-d-glucopyranoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 598.19 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 598.19 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 874.0 |
| Hydrogen Bond Acceptor Count | 15.0 |
| Molecular Weight | 598.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 10.0 |
| Iupac Name | 2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-3,4-dihydro-2H-chromene-4,5,7-triol |
| Total Atom Stereocenter Count | 13.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C27H34O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-37H,8H2,1H3/t9-,15+,17-,18+,19?,20+,21-,22+,23+,24?,25?,26+,27-/m0/s1 |
| Smiles | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3C(C4=C(C=C(C=C4OC3C5=CC=C(C=C5)O)O)O)O)O)O)O)O)O)O |
| Xlogp | -2.6 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C27H34O15 |
- 1. Outgoing r'ship
FOUND_INto/from Eriobotrya Japonica (Plant) Rel Props:Source_db:fooddb_chem_all