1-beta-Hydroxyeuscaphic acid
PubChem CID: 157009922
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1-beta-Hydroxyeuscaphic acid |
|---|---|
| Topological Polar Surface Area | 118.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | VULLSLYDWNGNKZ-RIXBZXPUSA-N |
| Rotatable Bond Count | 1.0 |
| Heavy Atom Count | 36.0 |
| Compound Name | 1-beta-Hydroxyeuscaphic acid |
| Description | 1-beta-hydroxyeuscaphic acid is also known as 1-β-hydroxyeuscaphate. 1-beta-hydroxyeuscaphic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). 1-beta-hydroxyeuscaphic acid can be found in loquat, which makes 1-beta-hydroxyeuscaphic acid a potential biomarker for the consumption of this food product. |
| Exact Mass | 504.345 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 504.345 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 990.0 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 504.7 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 10.0 |
| Iupac Name | (1R,2R,4aS,6aS,6bR,10S,11S,12S,12aR,14bS)-1,10,11,12-tetrahydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| Total Atom Stereocenter Count | 12.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C30H48O6/c1-16-10-13-30(24(34)35)15-14-26(4)17(21(30)29(16,7)36)8-9-19-27(26,5)12-11-18-25(2,3)22(32)20(31)23(33)28(18,19)6/h8,16,18-23,31-33,36H,9-15H2,1-7H3,(H,34,35)/t16-,18?,19?,20+,21-,22-,23-,26-,27-,28+,29-,30+/m1/s1 |
| Smiles | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4([C@@H]([C@H]([C@H](C5(C)C)O)O)O)C)C)[C@@H]2[C@]1(C)O)C)C(=O)O |
| Xlogp | 4.0 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C30H48O6 |
- 1. Outgoing r'ship
FOUND_INto/from Eriobotrya Japonica (Plant) Rel Props:Source_db:fooddb_chem_all