24-Ethylcholesta-5-en-7beta-ol
PubChem CID: 157009914
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 24-Ethylcholesta-5-en-7beta-ol |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | DYMJMYRIBWWKMH-WCZAINPMSA-N |
| Rotatable Bond Count | 6.0 |
| Heavy Atom Count | 30.0 |
| Compound Name | 24-Ethylcholesta-5-en-7beta-ol |
| Description | 24-ethylcholesta-5-en-7beta-ol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). 24-ethylcholesta-5-en-7beta-ol can be found in cucumber, which makes 24-ethylcholesta-5-en-7beta-ol a potential biomarker for the consumption of this food product. |
| Exact Mass | 414.386 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 414.386 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 634.0 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 414.7 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (7R,10R,13R)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-ol |
| Total Atom Stereocenter Count | 9.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C29H50O/c1-7-21(19(2)3)12-11-20(4)23-13-14-24-27-25(15-17-29(23,24)6)28(5)16-9-8-10-22(28)18-26(27)30/h18-21,23-27,30H,7-17H2,1-6H3/t20-,21?,23?,24?,25?,26+,27?,28+,29-/m1/s1 |
| Smiles | CCC(CC[C@@H](C)C1CCC2[C@@]1(CCC3C2[C@H](C=C4[C@@]3(CCCC4)C)O)C)C(C)C |
| Xlogp | 9.8 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C29H50O |
- 1. Outgoing r'ship
FOUND_INto/from Cucumis Sativus (Plant) Rel Props:Source_db:fooddb_chem_all