Melonin
PubChem CID: 157009910
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Melonin |
|---|---|
| Topological Polar Surface Area | 15.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | NEDKGJGWOHMJIS-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Heavy Atom Count | 21.0 |
| Compound Name | Melonin |
| Description | Melonin is a member of the class of compounds known as carbazoles. Carbazoles are compounds containing a three ring system containing a pyrrole ring fused on either side to a benzene ring. Melonin is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Melonin can be found in muskmelon, which makes melonin a potential biomarker for the consumption of this food product. |
| Exact Mass | 282.21 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 282.21 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 435.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 282.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 15-ethyl-2,11-diazapentacyclo[9.6.2.01,9.03,8.010,15]nonadeca-3,5,7-triene |
| Total Atom Stereocenter Count | 4.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C19H26N2/c1-2-18-8-5-12-21-13-11-19(10-9-18)16(17(18)21)14-6-3-4-7-15(14)20-19/h3-4,6-7,16-17,20H,2,5,8-13H2,1H3 |
| Smiles | CCC12CCCN3C1C4C5=CC=CC=C5NC4(CC2)CC3 |
| Xlogp | 3.8 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C19H26N2 |
- 1. Outgoing r'ship
FOUND_INto/from Cucumis Melo (Plant) Rel Props:Source_db:fooddb_chem_all