4alpha,14alpha,24-Trimethyl-cholesta-8(24)-dien-3beta-ol
PubChem CID: 157009889
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 4alpha,14alpha,24-Trimethyl-cholesta-8(24)-dien-3beta-ol |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | GCZFZGBLBXBCJP-BGXCJGIWSA-N |
| Rotatable Bond Count | 4.0 |
| Heavy Atom Count | 31.0 |
| Compound Name | 4alpha,14alpha,24-Trimethyl-cholesta-8(24)-dien-3beta-ol |
| Description | 4alpha,14alpha,24-trimethyl-cholesta-8(24)-dien-3beta-ol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). 4alpha,14alpha,24-trimethyl-cholesta-8(24)-dien-3beta-ol can be found in a number of food items such as green bell pepper, yellow bell pepper, orange bell pepper, and pepper (c. annuum), which makes 4alpha,14alpha,24-trimethyl-cholesta-8(24)-dien-3beta-ol a potential biomarker for the consumption of these food products. |
| Exact Mass | 426.386 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 426.386 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 769.0 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 426.7 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | (3S,4S,10S,13R,14R)-17-[(2R)-5,6-dimethylhept-5-en-2-yl]-4,10,13,14-tetramethyl-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| Total Atom Stereocenter Count | 8.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C30H50O/c1-19(2)20(3)9-10-21(4)23-13-17-30(8)26-12-11-24-22(5)27(31)15-16-28(24,6)25(26)14-18-29(23,30)7/h21-24,27,31H,9-18H2,1-8H3/t21-,22+,23?,24?,27+,28+,29-,30+/m1/s1 |
| Smiles | C[C@@H]1[C@H](CC[C@]2(C1CCC3=C2CC[C@]4([C@]3(CCC4[C@H](C)CCC(=C(C)C)C)C)C)C)O |
| Xlogp | 9.1 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C30H50O |
- 1. Outgoing r'ship
FOUND_INto/from Capsicum Annuum (Plant) Rel Props:Source_db:fooddb_chem_all