Luteolin 6-C-glucosyl-O-arabinoside
PubChem CID: 157009872
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Luteolin 6-C-glucosyl-O-arabinoside |
|---|---|
| Topological Polar Surface Area | 256.0 |
| Hydrogen Bond Donor Count | 10.0 |
| Inchi Key | MFKFVFBXHPTHOJ-NBRHCPASSA-N |
| Rotatable Bond Count | 6.0 |
| Heavy Atom Count | 41.0 |
| Compound Name | Luteolin 6-C-glucosyl-O-arabinoside |
| Description | Luteolin 6-c-glucosyl-o-arabinoside is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Luteolin 6-c-glucosyl-o-arabinoside can be found in oat, which makes luteolin 6-c-glucosyl-o-arabinoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 580.143 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 580.143 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 963.0 |
| Hydrogen Bond Acceptor Count | 15.0 |
| Molecular Weight | 580.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 9.0 |
| Iupac Name | 6-[(2S,3R,4R,5S,6R)-6-[[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| Total Atom Stereocenter Count | 9.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C26H28O15/c27-6-15-19(32)24(37)26(41-15)38-7-16-20(33)22(35)23(36)25(40-16)18-12(31)5-14-17(21(18)34)11(30)4-13(39-14)8-1-2-9(28)10(29)3-8/h1-5,15-16,19-20,22-29,31-37H,6-7H2/t15-,16-,19-,20-,22+,23-,24+,25+,26-/m1/s1 |
| Smiles | C1=CC(=C(C=C1C2=CC(=O)C3=C(O2)C=C(C(=C3O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@H]5[C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O)O)O)O |
| Xlogp | -1.7 |
| Is Pains | True |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C26H28O15 |
- 1. Outgoing r'ship
FOUND_INto/from Avena Sativa (Plant) Rel Props:Source_db:fooddb_chem_all