Dillanoside
PubChem CID: 157009861
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Dillanoside |
|---|---|
| Topological Polar Surface Area | 155.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | MNMKDPGRWWQDGI-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| Heavy Atom Count | 34.0 |
| Compound Name | Dillanoside |
| Description | Dillanoside is a member of the class of compounds known as isoflavones. Isoflavones are polycyclic compounds containing a 2-isoflavene skeleton which bears a ketone group at the C4 carbon atom. Dillanoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Dillanoside can be found in dill, which makes dillanoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 470.121 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 470.121 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 735.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 470.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 11-hydroxy-2-methoxy-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[a]xanthen-12-one |
| Total Atom Stereocenter Count | 5.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C24H22O10/c1-31-11-4-2-10-3-5-15-18(13(10)6-11)21(28)19-14(26)7-12(8-16(19)33-15)32-24-23(30)22(29)20(27)17(9-25)34-24/h2-8,17,20,22-27,29-30H,9H2,1H3 |
| Smiles | COC1=CC2=C(C=C1)C=CC3=C2C(=O)C4=C(C=C(C=C4O3)OC5C(C(C(C(O5)CO)O)O)O)O |
| Xlogp | 2.2 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C24H22O10 |
- 1. Outgoing r'ship
FOUND_INto/from Anethum Graveolens (Plant) Rel Props:Source_db:fooddb_chem_all