Prostaglandin A-1
PubChem CID: 157009857
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Prostaglandin A-1, 7-(2-((Z)-3-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl)heptanoic acid, 7-[2-[(Z)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid |
|---|---|
| Prediction Swissadme | 0.0 |
| Topological Polar Surface Area | 74.6 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | BGKHCLZFGPIKKU-OWBHPGMISA-N |
| Fcsp3 | 0.7 |
| Rotatable Bond Count | 13.0 |
| Heavy Atom Count | 24.0 |
| Compound Name | Prostaglandin A-1 |
| Description | Prostaglandin a-1 is a member of the class of compounds known as prostaglandins and related compounds. Prostaglandins and related compounds are unsaturated carboxylic acids consisting of a 20 carbon skeleton that also contains a five member ring, and are based upon the fatty acid arachidonic acid. Prostaglandin a-1 is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Prostaglandin a-1 can be found in garden onion and soft-necked garlic, which makes prostaglandin a-1 a potential biomarker for the consumption of these food products. |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 336.23 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 336.23 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 439.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 336.5 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 7-[2-[(Z)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 1.0 |
| Prediction Hob | 0.0 |
| Esol | -3.8149264000000005 |
| Inchi | InChI=1S/C20H32O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h12-18,21H,2-11H2,1H3,(H,23,24)/b14-12- |
| Smiles | CCCCCC(/C=C\C1C=CC(=O)C1CCCCCCC(=O)O)O |
| Xlogp | 4.4 |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C20H32O4 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:fooddb_chem_all