Acetoxy-[10]-gingerol
PubChem CID: 157009850
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Acetoxy-[10]-gingerol |
|---|---|
| Topological Polar Surface Area | 52.6 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | KRNPXTSKQYTSGR-QHCPKHFHSA-N |
| Rotatable Bond Count | 16.0 |
| Synonyms | Acetoxy-10-gingerol |
| Heavy Atom Count | 28.0 |
| Compound Name | Acetoxy-[10]-gingerol |
| Description | Acetoxy-[10]-gingerol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Acetoxy-[10]-gingerol can be found in ginger, which makes acetoxy-[10]-gingerol a potential biomarker for the consumption of this food product. |
| Exact Mass | 390.277 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 390.277 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 434.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 390.6 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | [(5S)-1-(3-methoxy-4-methylphenyl)-3-oxotetradecan-5-yl] acetate |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C24H38O4/c1-5-6-7-8-9-10-11-12-23(28-20(3)25)18-22(26)16-15-21-14-13-19(2)24(17-21)27-4/h13-14,17,23H,5-12,15-16,18H2,1-4H3/t23-/m0/s1 |
| Smiles | CCCCCCCCC[C@@H](CC(=O)CCC1=CC(=C(C=C1)C)OC)OC(=O)C |
| Xlogp | 6.6 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C24H38O4 |
- 1. Outgoing r'ship
FOUND_INto/from Zingiber Officinale (Plant) Rel Props:Source_db:fooddb_chem_all