(2E,10E)-11-(1,3-benzodioxol-5-yl)-N-butan-2-ylundeca-2,10-dienamide
PubChem CID: 157009849
Connections displayed (default: 10).
Loading graph...
| Topological Polar Surface Area | 47.6 |
|---|---|
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | ZPWYMHRULDAEAS-DCIPZJNNSA-N |
| Rotatable Bond Count | 11.0 |
| Heavy Atom Count | 26.0 |
| Compound Name | (2E,10E)-11-(1,3-benzodioxol-5-yl)-N-butan-2-ylundeca-2,10-dienamide |
| Description | Piperchabamide d is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Piperchabamide d can be found in pepper (spice), which makes piperchabamide d a potential biomarker for the consumption of this food product. |
| Exact Mass | 357.23 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 357.23 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 460.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 357.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (2E,10E)-11-(1,3-benzodioxol-5-yl)-N-butan-2-ylundeca-2,10-dienamide |
| Total Atom Stereocenter Count | 1.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 2.0 |
| Inchi | InChI=1S/C22H31NO3/c1-3-18(2)23-22(24)13-11-9-7-5-4-6-8-10-12-19-14-15-20-21(16-19)26-17-25-20/h10-16,18H,3-9,17H2,1-2H3,(H,23,24)/b12-10+,13-11+ |
| Smiles | CCC(C)NC(=O)/C=C/CCCCCC/C=C/C1=CC2=C(C=C1)OCO2 |
| Xlogp | 6.2 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 2.0 |
| Molecular Formula | C22H31NO3 |
- 1. Outgoing r'ship
FOUND_INto/from Piper Nigrum (Plant) Rel Props:Source_db:fooddb_chem_all